| id | C00000996 |
|---|---|
| Name | Abyssinin II / Abyssinoflavanone II / 5'-Prenylhomoeriodictyol |
| CAS RN | 671781-82-1 |
| Standard InChI | InChI=1S/C21H22O6/c1-11(2)4-5-12-6-13(7-19(26-3)21(12)25)17-10-16(24)20-15(23)8-14(22)9-18(20)27-17/h4,6-9,17,22-23,25H,5,10H2,1-3H3/t17-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O6/c1-11(2)4-5-12-6-13(7-19(26-3)21(12)25)17-10-16(24)20-15(23)8-14(22)9-18(20)27-17/h4,6-9,17,22-23,25H,5,10H2,1-3H3 |
| Phytochemical cluster | No. 14 |
|---|---|
| KCF-S cluster | No. 28 |
| By standard InChI | CHEMBL388722 |
|---|---|
| By standard InChI Main Layer | CHEMBL388722 |
| By LinkDB | C09831 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Erythrina abyssinica | 1237573 | Fabaceae | rosids | Viridiplantae |
| Erythrina berteroana | 3841 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL388722 |
CHEMBL904966
(1)
|
0 / 0 |