id | C00000102 |
---|---|
Name | 4-Chloro-IAA / 4-Chloroindole-3-acetic acid |
CAS RN | 2519-61-1 |
Standard InChI | InChI=1S/C10H8ClNO2/c11-7-2-1-3-8-10(7)6(5-12-8)4-9(13)14/h1-3,5,12H,4H2,(H,13,14) |
Standard InChI (Main Layer) | InChI=1S/C10H8ClNO2/c11-7-2-1-3-8-10(7)6(5-12-8)4-9(13)14/h1-3,5,12H,4H2,(H,13,14) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 4225 |
By standard InChI | CHEMBL309993 |
---|---|
By standard InChI Main Layer | CHEMBL309993 |
By LinkDB |
---|
By CAS RN | C096198 |
---|
class name | count |
---|---|
rosids | 9 |
Spermatophyta | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P02768 | Serum albumin | Secreted protein | CHEMBL309993 |
CHEMBL894775
(1)
|
0 / 0 |