| id | C00001044 |
|---|---|
| Name | Ginkgetin / 7,4'-Dimethylamentoflavone / Amentoflavone 7'',4'''-dimethyl ether |
| CAS RN | 481-46-9 |
| Standard InChI | InChI=1S/C32H22O10/c1-39-18-10-20(34)30-23(37)13-27(41-28(30)11-18)16-5-8-25(40-2)19(9-16)29-21(35)12-22(36)31-24(38)14-26(42-32(29)31)15-3-6-17(33)7-4-15/h3-14,33-36H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C32H22O10/c1-39-18-10-20(34)30-23(37)13-27(41-28(30)11-18)16-5-8-25(40-2)19(9-16)29-21(35)12-22(36)31-24(38)14-26(42-32(29)31)15-3-6-17(33)7-4-15/h3-14,33-36H,1-2H3 |
| Phytochemical cluster | No. 18 |
|---|---|
| KCF-S cluster | No. 34 |
| By standard InChI | CHEMBL377324 |
|---|---|
| By standard InChI Main Layer | CHEMBL377324 |
| By LinkDB | C10048 |
|---|
| By CAS RN | C077458 |
|---|
| class name | count |
|---|---|
| Spermatophyta | 14 |
| Embryophyta | 1 |
| rosids | 1 |
| family name | count |
|---|---|
| Taxaceae | 5 |
| Podocarpaceae | 3 |
| Zamiaceae | 2 |
| Cycadaceae | 1 |
| Cephalotaxaceae | 1 |
| Ginkgoaceae | 1 |
| Cupressaceae | 1 |
| Selaginellaceae | 1 |
| Euphorbiaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P56817 | Beta-secretase 1 | A1A | CHEMBL377324 |
CHEMBL1211753
(1)
|
0 / 0 |