| id | C00001165 |
|---|---|
| Name | Mannitol / D-Mannitol |
| CAS RN | 69-65-8 |
| Standard InChI | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 630 |
| By standard InChI | CHEMBL689 |
|---|---|
| By standard InChI Main Layer | CHEMBL16105 CHEMBL689 CHEMBL1682 CHEMBL1735282 CHEMBL1773904 |
| By LinkDB | C00392 |
|---|
| By CAS RN | D008353 |
|---|
| class name | count |
|---|---|
| asterids | 11 |
| Magnoliophyta | 2 |
| Liliopsida | 1 |
| eudicotyledons | 1 |
| rosids | 1 |
| family name | count |
|---|---|
| Plantaginaceae | 7 |
| Canellaceae | 2 |
| Apiaceae | 2 |
| Rubiaceae | 1 |
| Amaryllidaceae | 1 |
| Orobanchaceae | 1 |
| Tamaricaceae | 1 |
| Brassicaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL689 |
CHEMBL1909136
(2)
|
1 / 0 |
| P10323 | Acrosin | S1A | CHEMBL689 CHEMBL1682 |
CHEMBL639765
(2)
|
0 / 0 |
| P21728 | D(1A) dopamine receptor | Dopamine receptor | CHEMBL689 |
CHEMBL1909139
(2)
|
0 / 0 |
| P27338 | Amine oxidase [flavin-containing] B | Oxidoreductase | CHEMBL689 |
CHEMBL965567
(1)
|
0 / 0 |
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL689 |
CHEMBL1909131
(2)
|
0 / 3 |
| Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL689 |
CHEMBL1909190
(2)
|
2 / 2 |
| P08246 | Neutrophil elastase | S1A | CHEMBL689 |
CHEMBL1909195
(2)
|
2 / 1 |
| P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL689 |
CHEMBL1909215
(2)
|
0 / 0 |
| Q16539 | Mitogen-activated protein kinase 14 | p38 | CHEMBL689 |
CHEMBL1909201
(2)
|
0 / 0 |
| P49146 | Neuropeptide Y receptor type 2 | Neuropeptide Y receptor | CHEMBL689 |
CHEMBL1909176
(2)
|
0 / 0 |
| P29466 | Caspase-1 | C14 | CHEMBL689 |
CHEMBL1909193
(2)
|
0 / 0 |
| P17252 | Protein kinase C alpha type | Alpha | CHEMBL689 |
CHEMBL1909198
(2)
|
0 / 0 |
| P27361 | Mitogen-activated protein kinase 3 | Erk | CHEMBL689 |
CHEMBL1909199
(2)
|
0 / 0 |
| P14780 | Matrix metalloproteinase-9 | M10A | CHEMBL689 |
CHEMBL1909197
(2)
|
2 / 2 |
| O15245 | Solute carrier family 22 member 1 | Drug uniporter | CHEMBL689 |
CHEMBL993349
(1)
|
0 / 0 |
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL16105 CHEMBL689 |
CHEMBL1614544
(3)
|
11 / 10 |
| P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL689 |
CHEMBL1909123
(2)
|
1 / 2 |
| P07550 | Beta-2 adrenergic receptor | Adrenergic receptor | CHEMBL689 |
CHEMBL1909092
(2)
|
0 / 1 |
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL689 |
CHEMBL965566
(1)
CHEMBL1909169
(2)
|
1 / 1 |
| P25021 | Histamine H2 receptor | Histamine receptor | CHEMBL689 |
CHEMBL1909157
(2)
|
0 / 0 |
| P35367 | Histamine H1 receptor | Histamine receptor | CHEMBL689 |
CHEMBL1909156
(2)
|
0 / 0 |
| Q01959 | Sodium-dependent dopamine transporter | Dopamine | CHEMBL689 |
CHEMBL1909143
(2)
|
1 / 0 |
| P08912 | Muscarinic acetylcholine receptor M5 | Acetylcholine receptor | CHEMBL689 |
CHEMBL1909174
(2)
|
0 / 0 |
| P18825 | Alpha-2C adrenergic receptor | Adrenergic receptor | CHEMBL689 |
CHEMBL1909090
(2)
|
0 / 0 |
| P13945 | Beta-3 adrenergic receptor | Adrenergic receptor | CHEMBL689 |
CHEMBL1909093
(2)
|
0 / 0 |
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL689 |
CHEMBL1908285
(2)
CHEMBL1908286
(2)
CHEMBL1908287 (1) CHEMBL1908288 (1) CHEMBL1908289 (2) CHEMBL1908290 (1) CHEMBL1908291 (1) CHEMBL1908292 (1) CHEMBL2076205 (1) |
1 / 0 |
| P25024 | C-X-C chemokine receptor type 1 | CXC chemokine receptor | CHEMBL689 |
CHEMBL1909127
(2)
|
0 / 0 |
| P06241 | Tyrosine-protein kinase Fyn | Src | CHEMBL689 |
CHEMBL1909204
(2)
|
0 / 0 |
| Q08209 | Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform | Ser_Thr | CHEMBL689 |
CHEMBL1909202
(2)
|
0 / 0 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL689 |
CHEMBL1909135
(2)
|
0 / 1 |
| P00533 | Epidermal growth factor receptor | TK tyrosine-protein kinase EGFR subfamily | CHEMBL689 |
CHEMBL1909203
(2)
|
1 / 11 |
| P14416 | D(2) dopamine receptor | Dopamine receptor | CHEMBL689 |
CHEMBL1909140
(2)
|
2 / 0 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL689 |
CHEMBL1909130
(2)
|
0 / 0 |
| P37288 | Vasopressin V1a receptor | Vasopressin and oxytocin receptor | CHEMBL689 |
CHEMBL1909120
(2)
|
0 / 0 |
| P41145 | Kappa-type opioid receptor | Opioid receptor | CHEMBL689 |
CHEMBL1909181
(2)
|
0 / 0 |
| Q9Y271 | Cysteinyl leukotriene receptor 1 | Leukotriene receptor | CHEMBL689 |
CHEMBL1909164
(2)
|
0 / 0 |
| P29274 | Adenosine receptor A2a | Adenosine receptor | CHEMBL689 |
CHEMBL1909214
(2)
|
0 / 0 |
| P25929 | Neuropeptide Y receptor type 1 | Neuropeptide Y receptor | CHEMBL689 |
CHEMBL1909175
(2)
|
0 / 0 |
| P50052 | Type-2 angiotensin II receptor | Angiotensin receptor | CHEMBL689 |
CHEMBL1909096
(2)
|
1 / 1 |
| P17948 | Vascular endothelial growth factor receptor 1 | Vegfr | CHEMBL689 |
CHEMBL1909118
(2)
|
0 / 0 |
| P41968 | Melanocortin receptor 3 | Melanocortin receptor | CHEMBL689 |
CHEMBL1909166
(2)
|
1 / 0 |
| P11509 | Cytochrome P450 2A6 | Cytochrome P450 2A6 | CHEMBL689 |
CHEMBL1909133
(2)
|
0 / 0 |
| P39748 | Flap endonuclease 1 | Enzyme | CHEMBL1682 |
CHEMBL1794486
(1)
|
0 / 0 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1735282 |
CHEMBL1738606
(1)
|
0 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL689 CHEMBL1682 |
CHEMBL2114843
(1)
CHEMBL2114780
(1)
|
0 / 0 |
| P04035 | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | Oxidoreductase | CHEMBL689 |
CHEMBL1909158
(2)
|
0 / 0 |
| P08913 | Alpha-2A adrenergic receptor | Adrenergic receptor | CHEMBL689 |
CHEMBL1909088
(2)
|
0 / 0 |
| P21917 | D(4) dopamine receptor | Dopamine receptor | CHEMBL689 |
CHEMBL1909142
(2)
|
0 / 0 |
| P30988 | Calcitonin receptor | Calcitonin receptor | CHEMBL689 |
CHEMBL1909101
(2)
|
0 / 0 |
| P35462 | D(3) dopamine receptor | Dopamine receptor | CHEMBL689 |
CHEMBL1909141
(2)
|
1 / 0 |
| P41143 | Delta-type opioid receptor | Opioid receptor | CHEMBL689 |
CHEMBL1909180
(2)
|
0 / 0 |
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL689 |
CHEMBL1909146
(2)
|
0 / 1 |
| P41595 | 5-hydroxytryptamine receptor 2B | Serotonin receptor | CHEMBL689 |
CHEMBL1909104
(2)
|
0 / 0 |
| P25101 | Endothelin-1 receptor | Endothelin receptor | CHEMBL689 |
CHEMBL1909144
(2)
|
0 / 0 |
| P30411 | B2 bradykinin receptor | Bradykinin receptor | CHEMBL689 |
CHEMBL1909100
(2)
|
0 / 0 |
| P32245 | Melanocortin receptor 4 | Melanocortin receptor | CHEMBL689 |
CHEMBL1909167
(2)
|
1 / 0 |
| P32238 | Cholecystokinin receptor type A | Cholecystokinin receptor | CHEMBL689 |
CHEMBL1909129
(2)
|
0 / 0 |
| P08311 | Cathepsin G | S1A | CHEMBL689 |
CHEMBL1909194
(2)
|
0 / 0 |
| Q99720 | Sigma non-opioid intracellular receptor 1 | Membrane receptor | CHEMBL689 |
CHEMBL1909110
(2)
|
1 / 0 |
| P03956 | Interstitial collagenase | M10A | CHEMBL689 |
CHEMBL1909196
(2)
|
0 / 1 |
| P32241 | Vasoactive intestinal polypeptide receptor 1 | Vasoactive intestinal peptide receptor | CHEMBL689 |
CHEMBL1909119
(2)
|
0 / 0 |
| Q9Y468 | Lethal(3)malignant brain tumor-like protein 1 | Unclassified protein | CHEMBL689 |
CHEMBL1614280
(1)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1682 |
CHEMBL1794401
(1)
|
0 / 0 |
| P04150 | Glucocorticoid receptor | NR3C1 | CHEMBL689 |
CHEMBL1794456
(1)
CHEMBL1909150
(2)
|
0 / 1 |
| P08172 | Muscarinic acetylcholine receptor M2 | Acetylcholine receptor | CHEMBL689 |
CHEMBL1909171
(2)
|
2 / 0 |
| P11229 | Muscarinic acetylcholine receptor M1 | Acetylcholine receptor | CHEMBL689 |
CHEMBL1909170
(2)
|
0 / 0 |
| P21554 | Cannabinoid receptor 1 | Cannabinoid receptor | CHEMBL689 |
CHEMBL1909122
(2)
|
0 / 0 |
| P31645 | Sodium-dependent serotonin transporter | Serotonin | CHEMBL689 |
CHEMBL1909109
(2)
|
2 / 0 |
| P04626 | Receptor tyrosine-protein kinase erbB-2 | TK tyrosine-protein kinase EGFR subfamily | CHEMBL689 |
CHEMBL1909205
(2)
|
5 / 10 |
| P20309 | Muscarinic acetylcholine receptor M3 | Acetylcholine receptor | CHEMBL689 |
CHEMBL1909172
(2)
|
1 / 0 |
| P21452 | Substance-K receptor | Neurokinin receptor | CHEMBL689 |
CHEMBL1909114
(2)
|
0 / 0 |
| P51679 | C-C chemokine receptor type 4 | CC chemokine receptor | CHEMBL689 |
CHEMBL1909125
(2)
|
0 / 0 |
| P51681 | C-C chemokine receptor type 5 | CC chemokine receptor | CHEMBL689 |
CHEMBL1909126
(2)
|
3 / 0 |
| P50406 | 5-hydroxytryptamine receptor 6 | Serotonin receptor | CHEMBL689 |
CHEMBL1909108
(2)
|
0 / 0 |
| P41597 | C-C chemokine receptor type 2 | CC chemokine receptor | CHEMBL689 |
CHEMBL1909124
(2)
|
1 / 0 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL689 |
CHEMBL1909200
(2)
|
0 / 0 |
| P08575 | Receptor-type tyrosine-protein phosphatase C | Enzyme | CHEMBL689 |
CHEMBL1909207
(2)
|
2 / 1 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL689 |
CHEMBL1909132
(2)
|
0 / 0 |
| O76074 | cGMP-specific 3',5'-cyclic phosphodiesterase | PDE_5A | CHEMBL689 |
CHEMBL1909186
(2)
|
0 / 0 |
| P03372 | Estrogen receptor | NR3A1 | CHEMBL689 |
CHEMBL1794542
(1)
CHEMBL1909145
(2)
|
1 / 1 |
| P08588 | Beta-1 adrenergic receptor | Adrenergic receptor | CHEMBL689 |
CHEMBL1909091
(2)
|
1 / 0 |
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL689 |
CHEMBL1909212
(2)
|
1 / 0 |
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL689 |
CHEMBL1909211
(2)
|
0 / 0 |
| P28335 | 5-hydroxytryptamine receptor 2C | Serotonin receptor | CHEMBL689 |
CHEMBL1909105
(2)
|
0 / 0 |
| P35372 | Mu-type opioid receptor | Opioid receptor | CHEMBL689 |
CHEMBL1909182
(2)
|
0 / 0 |
| P08173 | Muscarinic acetylcholine receptor M4 | Acetylcholine receptor | CHEMBL689 |
CHEMBL1909173
(2)
|
0 / 0 |
| P25103 | Substance-P receptor | Neurokinin receptor | CHEMBL689 |
CHEMBL1909113
(2)
|
0 / 0 |
| P25105 | Platelet-activating factor receptor | PAF receptor | CHEMBL689 |
CHEMBL1909187
(2)
|
0 / 0 |
| P33032 | Melanocortin receptor 5 | Melanocortin receptor | CHEMBL689 |
CHEMBL1909168
(2)
|
0 / 0 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL689 |
CHEMBL1909134
(2)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL689 |
CHEMBL1909138
(2)
|
0 / 1 |
| P05181 | Cytochrome P450 2E1 | Cytochrome P450 2E1 | CHEMBL689 |
CHEMBL1909137
(2)
|
0 / 0 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL689 |
CHEMBL2114890
(1)
|
0 / 0 |
| P23975 | Sodium-dependent noradrenaline transporter | Norepinephrine | CHEMBL689 |
CHEMBL1909094
(2)
|
1 / 1 |
| P25100 | Alpha-1D adrenergic receptor | Adrenergic receptor | CHEMBL689 |
CHEMBL1909087
(2)
|
0 / 0 |
| P30542 | Adenosine receptor A1 | Adenosine receptor | CHEMBL689 |
CHEMBL1909213
(2)
|
0 / 0 |
| P18089 | Alpha-2B adrenergic receptor | Adrenergic receptor | CHEMBL689 |
CHEMBL1909089
(2)
|
0 / 0 |
| P24557 | Thromboxane-A synthase | Cytochrome P450 5A1 | CHEMBL689 |
CHEMBL1909116
(2)
|
1 / 1 |
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL689 |
CHEMBL1909206
(2)
|
0 / 1 |
| P25025 | C-X-C chemokine receptor type 2 | CXC chemokine receptor | CHEMBL689 |
CHEMBL1909128
(2)
|
0 / 0 |
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL689 |
CHEMBL2354287
(1)
|
1 / 1 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| D008353 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | IGF1 inhibits the reaction [Mannitol results in increased activity of CASP3 protein] |
decreases reaction
/ increases activity |
protein |
10567913
|
| D008353 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | Mannitol results in increased activity of CASP3 protein |
increases activity
|
protein |
10567913
12011046 |
| D008353 | 842 |
CASP9
APAF-3 APAF3 ICE-LAP6 MCH6 PPP1R56 |
caspase 9, apoptosis-related cysteine peptidase (EC:3.4.22.62) | Mannitol results in increased activity of CASP9 protein |
increases activity
|
protein |
12011046
|
| D008353 | 3479 |
IGF1
IGF-I IGF1A IGFI |
insulin-like growth factor 1 (somatomedin C) | IGF1 inhibits the reaction [Mannitol results in increased activity of CASP3 protein] |
decreases reaction
/ increases activity |
10567913
|
|
| D008353 | 5594 |
MAPK1
ERK ERK2 ERT1 MAPK2 P42MAPK PRKM1 PRKM2 p38 p40 p41 p41mapk |
mitogen-activated protein kinase 1 (EC:2.7.11.24) | Mannitol promotes the reaction [potassium chromate(VI) results in increased phosphorylation of MAPK1 protein] |
increases phosphorylation
/ increases reaction |
protein |
10910949
|
| D008353 | 5599 |
MAPK8
JNK JNK-46 JNK1 JNK1A2 JNK21B1/2 PRKM8 SAPK1 SAPK1c |
mitogen-activated protein kinase 8 (EC:2.7.11.24) | Mannitol promotes the reaction [potassium chromate(VI) results in increased phosphorylation of MAPK8 protein] |
increases phosphorylation
/ increases reaction |
protein |
10910949
|
| D008353 | 4878 |
NPPA
ANF ANP ATFB6 CDD-ANF PND |
natriuretic peptide A | Mannitol results in increased expression of NPPA protein |
increases expression
|
protein |
2177369
|
| D008353 | 27250 |
PDCD4
H731 |
programmed cell death 4 (neoplastic transformation inhibitor) | Mannitol results in decreased expression of PDCD4 mRNA |
decreases expression
|
mRNA |
21873647
|
| D008353 | 27250 |
PDCD4
H731 |
programmed cell death 4 (neoplastic transformation inhibitor) | Mannitol results in increased expression of PDCD4 mRNA |
increases expression
|
mRNA |
21873647
|
| D008353 | 5747 |
PTK2
FADK FAK FAK1 FRNK PPP1R71 p125FAK pp125FAK |
protein tyrosine kinase 2 (EC:2.7.10.2) | benzyloxycarbonyl-valyl-alanyl-aspartic acid inhibits the reaction [Mannitol results in decreased phosphorylation of and results in increased degradation of PTK2 protein] |
decreases phosphorylation
/ decreases reaction / increases degradation |
protein |
12011046
|
| D008353 | 5747 |
PTK2
FADK FAK FAK1 FRNK PPP1R71 p125FAK pp125FAK |
protein tyrosine kinase 2 (EC:2.7.10.2) | Mannitol results in decreased phosphorylation of and results in increased degradation of PTK2 protein |
decreases phosphorylation
/ increases degradation |
protein |
12011046
|
| D008353 | 7128 |
TNFAIP3
A20 OTUD7C TNFA1P2 |
tumor necrosis factor, alpha-induced protein 3 (EC:3.4.19.12) | Mannitol results in increased expression of TNFAIP3 mRNA |
increases expression
|
mRNA |
21873647
|
| D008353 | 7163 |
TPD52
D52 N8L PC-1 PrLZ hD52 |
tumor protein D52 | Mannitol results in decreased expression of TPD52 mRNA |
decreases expression
|
mRNA |
21873647
|
| D008353 | 7163 |
TPD52
D52 N8L PC-1 PrLZ hD52 |
tumor protein D52 | Mannitol results in increased expression of TPD52 mRNA |
increases expression
|
mRNA |
21873647
|
| OMIM | preferred title | UniProt |
|---|---|---|
| #100100 | Abdominal muscles, absence of, with urinary tract abnormality and cryptorchidism |
P20309
|
| #103780 | Alcohol dependence |
P08172
P14416 P31645 |
| #612069 | Amyotrophic lateral sclerosis 10, with or without frontotemporal dementia; als10 |
Q13148
|
| #614373 | Amyotrophic lateral sclerosis 16, juvenile; als16 |
Q99720
|
| #602025 | Body mass index quantitative trait locus 9; bmiq9 |
P41968
|
| #300615 | Brunner syndrome |
P21397
|
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a |
P02545
|
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism |
P02545
|
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 |
P02545
|
| #162800 | Cyclic neutropenia |
P08246
|
| #612522 | Diabetes mellitus, insulin-dependent, 22; iddm22 |
P51681
|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 |
P02545
|
| #615363 | Estrogen resistance; estrr |
P03372
|
| #613659 | Gastric cancer |
P04626
|
| #137215 | Gastric cancer, hereditary diffuse; hdgc |
P04626
|
| #231095 | Ghosal hematodiaphyseal dysplasia; ghdd |
P24557
|
| #137800 | Glioma susceptibility 1; glm1 |
P04626
|
| #610140 | Heart-hand syndrome, slovenian type |
P02545
|
| #609423 | Human immunodeficiency virus type 1, susceptibility to |
P41597
P51681 |
| #176670 | Hutchinson-gilford progeria syndrome; hgps |
P02545
|
| #612244 | Inflammatory bowel disease 13; ibd13 |
P08183
|
| #603932 | Intervertebral disc disease; idd |
P14780
|
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 |
P02545
|
| #613688 | Long qt syndrome 2; lqt2 |
Q12809
|
| #211980 | Lung cancer |
P00533
P04626 |
| #608516 | Major depressive disorder; mdd |
P08172
|
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada |
P02545
|
| %300852 | Mental retardation, x-linked 88; mrx88 |
P50052
|
| #613073 | Metaphyseal anadysplasia 2; mandp2 |
P14780
|
| #126200 | Multiple sclerosis, susceptibility to; ms |
P08575
|
| #613205 | Muscular dystrophy, congenital, lmna-related |
P02545
|
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b |
P02545
|
| #159900 | Myoclonic dystonia |
P14416
|
| #202700 | Neutropenia, severe congenital, 1, autosomal dominant; scn1 |
P08246
|
| #601665 | Obesity |
P32245
|
| #164230 | Obsessive-compulsive disorder; ocd |
P31645
|
| #604715 | Orthostatic intolerance |
P23975
|
| #259730 | Osteopetrosis, autosomal recessive 3; optb3 |
P00918
|
| #167000 | Ovarian cancer |
P04626
|
| #613135 | Parkinsonism-dystonia, infantile; pkdys |
Q01959
|
| #607276 | Resting heart rate, variation in |
P08588
|
| #275210 | Restrictive dermopathy, lethal |
P02545
|
| #608971 | Severe combined immunodeficiency, autosomal recessive, t cell-negative, b cell-positive, nk cell-positive |
P08575
|
| #609620 | Short qt syndrome 1; sqt1 |
Q12809
|
| #190300 | Tremor, hereditary essential, 1; etm1 |
P35462
|
| #610379 | West nile virus, susceptibility to |
P51681
|
| #112100 | Yt blood group antigen |
P22303
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00016 | Oral cancer |
P00533
(related)
P00533 (marker) |
| H00017 | Esophageal cancer |
P00533
(related)
P35354 (related) |
| H00018 | Gastric cancer |
P00533
(related)
P04626 (related) |
| H00022 | Bladder cancer |
P00533
(related)
P04626 (related) |
| H00028 | Choriocarcinoma |
P00533
(related)
P03956 (related) P04626 (related) |
| H00030 | Cervical cancer |
P00533
(related)
P04626 (related) |
| H00042 | Glioma |
P00533
(related)
P00533 (marker) |
| H00055 | Laryngeal cancer |
P00533
(related)
P00533 (marker) |
| H00241 | Combined proximal and distal renal tubular acidosis (RTA type 3) |
P00918
(related)
|
| H00436 | Osteopetrosis |
P00918
(related)
|
| H00264 | Charcot-Marie-Tooth disease (CMT) |
P02545
(related)
|
| H00294 | Dilated cardiomyopathy (DCM) |
P02545
(related)
|
| H00420 | Familial partial lipodystrophy (FPL) |
P02545
(related)
|
| H00563 | Emery-Dreifuss muscular dystrophy |
P02545
(related)
|
| H00590 | Congenital muscular dystrophies (CMD/MDC) |
P02545
(related)
|
| H00593 | Limb-girdle muscular dystrophy (LGMD) |
P02545
(related)
|
| H00601 | Hutchinson-Gilford progeria syndrome |
P02545
(related)
|
| H00663 | Restrictive dermopathy |
P02545
(related)
|
| H00665 | Mandibuloacral dysplasia |
P02545
(related)
|
| H01216 | Left ventricular noncompaction (LVNC) |
P02545
(related)
|
| H00026 | Endometrial Cancer |
P03372
(marker)
P04626 (related) Q92731 (marker) |
| H00599 | 46,XX disorders of sex development (Disorders related to androgen excess) |
P04150
(related)
|
| H00019 | Pancreatic cancer |
P04626
(related)
|
| H00027 | Ovarian cancer |
P04626
(related)
|
| H00031 | Breast cancer |
P04626
(related)
P04626 (marker) |
| H00046 | Cholangiocarcinoma |
P04626
(related)
P35354 (related) |
| H00093 | Combined immunodeficiencies (CIDs) |
P06239
(related)
|
| H00079 | Asthma |
P07550
(related)
|
| H00100 | Neutropenic disorders |
P08246
(related)
|
| H00091 | T-B+Severe combined immunodeficiencies (SCIDs) |
P08575
(related)
|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H00025 | Penile cancer |
P14780
(related)
P35354 (related) |
| H00479 | Metaphyseal dysplasias |
P14780
(related)
|
| H00548 | Brunner syndrome |
P21397
(related)
|
| H01031 | Orthostatic intolerance (OI) |
P23975
(related)
|
| H00490 | Diaphyseal dysplasia with anemia (Ghosal) |
P24557
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|
| H00480 | Non-syndromic X-linked mental retardation |
P50052
(related)
|
| H00720 | Long QT syndrome |
Q12809
(related)
|
| H00725 | Short QT syndrome |
Q12809
(related)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
Q13148
(related)
|
| MeSH disease | OMIM | compound | disease name | evidence type |
reference
pmid |
|---|---|---|---|---|---|
| D058186 | D008353 | Acute Kidney Injury |
marker/mechanism
therapeutic |
513486
691972 735158 1751788 2111870 2500855 2513521 3015452 3086006 3106845 5695673 6435559 6437357 6769339 7724007 7734574 7900744 7991027 8184141 8379473 8431614 8529299 8856292 9038039 9189872 9590800 11247599 12381962 14599652 16235675 18093429 20118599 20557870 |
|
| D055371 | D008353 | Acute Lung Injury |
therapeutic
|
21748612
|
|
| D053099 | D008353 | Azotemia |
marker/mechanism
|
5087393
|
|
| D001929 | D008353 | Brain Edema |
marker/mechanism
therapeutic |
8184141
8630150 10742073 15519365 17019386 |
|
| D002545 | D008353 | Brain Ischemia |
therapeutic
|
6799378
|
|
| D002543 | D008353 | Cerebral Hemorrhage |
marker/mechanism
therapeutic |
6411871
11897545 12691796 |
|
| D003128 | D008353 | COMA |
marker/mechanism
|
17333050
|
|
| D003161 | D008353 | Compartment Syndromes |
marker/mechanism
|
15462158
17335600 |
|
| D006259 | D008353 | Craniocerebral Trauma |
therapeutic
|
3151702
10067030 |
|
| D003875 | D008353 | Drug Eruptions |
marker/mechanism
|
11792017
|
|
| D064420 | D008353 | Drug-Related Side Effects and Adverse Reactions |
marker/mechanism
therapeutic |
5082364
11247599 |
|
| D004487 | D008353 | Edema |
therapeutic
|
14718644
|
|
| D004660 | D008353 | Encephalitis |
marker/mechanism
|
6424993
|
|
| D005901 | D008353 | Glaucoma |
therapeutic
|
3106845
|
|
| D015812 | D008353 | Glaucoma, Angle-Closure |
therapeutic
|
7900744
|
|
| D005910 | D008353 | Glioma |
therapeutic
|
17019386
|
|
| D034381 | D008353 | Hearing Loss |
therapeutic
|
9223576
|
|
| D006331 | D008353 | Heart Diseases |
marker/mechanism
|
8184141
|
|
| D006505 | D008353 | Hepatitis |
therapeutic
|
11182525
|
|
| D006955 | D008353 | Hypernatremia |
marker/mechanism
|
20804114
|
|
| D007008 | D008353 | Hypokalemia |
marker/mechanism
|
20804114
|
|
| D007010 | D008353 | Hyponatremia |
marker/mechanism
therapeutic |
3919450
17333050 20804114 |
|
| D007022 | D008353 | Hypotension |
marker/mechanism
|
32802
571222 10067030 16671420 |
|
| D007177 | D008353 | Inappropriate ADH Syndrome |
therapeutic
|
3919450
|
|
| D019586 | D008353 | Intracranial Hypertension |
marker/mechanism
therapeutic |
2111870
3151702 6437357 8379473 15829166 16302998 17019386 |
|
| D002546 | D008353 | Ischemic Attack, Transient |
therapeutic
|
11086739
|
|
| D007674 | D008353 | Kidney Diseases |
marker/mechanism
therapeutic |
1436300
5082364 6785722 10399635 19535188 |
|
| D008579 | D008353 | Meningioma |
therapeutic
|
17019386
|
|
| D017202 | D008353 | Myocardial Ischemia |
therapeutic
|
4640943
|
|
| D009336 | D008353 | Necrosis |
therapeutic
|
963849
11086739 15786717 |
|
| D009401 | D008353 | Nephrosis |
marker/mechanism
|
5415710
7003672 |
|
| D009422 | D008353 | Nervous System Diseases |
therapeutic
|
2554183
|
|
| D009846 | D008353 | Oliguria |
marker/mechanism
|
8529299
|
|
| D054038 | D008353 | Posterior Leukoencephalopathy Syndrome |
therapeutic
|
11862771
|
|
| D011654 | D008353 | Pulmonary Edema |
marker/mechanism
therapeutic |
6781355
6784656 21748612 |
|
| D011655 | D008353 | Pulmonary Embolism |
marker/mechanism
therapeutic |
2510358
6766842 |
|
| D051437 | D008353 | Renal Insufficiency |
marker/mechanism
|
3925648
6781355 |
|
| D015427 | D008353 | Reperfusion Injury |
therapeutic
|
21748612
|
|
| D012769 | D008353 | Shock |
therapeutic
|
16302998
|
|
| D020521 | D008353 | Stroke |
therapeutic
|
2177369
|
|
| D014581 | D008353 | Urticaria |
marker/mechanism
|
11792017
|
|
| D014693 | D008353 | Ventricular Fibrillation |
marker/mechanism
|
2745010
|