| id | C00013421 |
|---|---|
| Name | Heteroartonin A / 2-[2,5-Dihydroxy-4-methoxy-3-(3-methyl-2-butenyl)phenyl]-5,7-dihydroxy-3-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one |
| CAS RN | 170894-23-2 |
| Standard InChI | InChI=1S/C26H28O7/c1-13(2)6-8-16-23(30)18(12-20(29)26(16)32-5)25-17(9-7-14(3)4)24(31)22-19(28)10-15(27)11-21(22)33-25/h6-7,10-12,27-30H,8-9H2,1-5H3 |
| Standard InChI (Main Layer) | InChI=1S/C26H28O7/c1-13(2)6-8-16-23(30)18(12-20(29)26(16)32-5)25-17(9-7-14(3)4)24(31)22-19(28)10-15(27)11-21(22)33-25/h6-7,10-12,27-30H,8-9H2,1-5H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 14 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Artocarpus fretessi | 3488 | Moraceae | rosids | Viridiplantae |
| Artocarpus heterophyllus | 3489 | Moraceae | rosids | Viridiplantae |