| id | C00001561 |
|---|---|
| Name | Ambelline / (-)-Ambelline |
| CAS RN | 3660-62-6 |
| Standard InChI | InChI=1S/C18H21NO5/c1-21-10-3-4-18-12-6-13-17(24-9-23-13)16(22-2)11(12)7-19(8-15(18)20)14(18)5-10/h3-4,6,10,14-15,20H,5,7-9H2,1-2H3/t10-,14+,15-,18+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H21NO5/c1-21-10-3-4-18-12-6-13-17(24-9-23-13)16(22-2)11(12)7-19(8-15(18)20)14(18)5-10/h3-4,6,10,14-15,20H,5,7-9H2,1-2H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 103 |
| By standard InChI | CHEMBL1173110 |
|---|---|
| By standard InChI Main Layer | CHEMBL1173110 CHEMBL1600436 CHEMBL1980252 |
| By LinkDB | C08517 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 10 |
| family name | count |
|---|---|
| Amaryllidaceae | 10 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1600436 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |