| id | C00001778 |
|---|---|
| Name | Tubulosine / (-)-Tubulosine |
| CAS RN | 2632-29-3 |
| Standard InChI | InChI=1S/C29H37N3O3/c1-4-17-16-32-10-8-18-13-27(34-2)28(35-3)15-22(18)26(32)12-19(17)11-25-29-21(7-9-30-25)23-14-20(33)5-6-24(23)31-29/h5-6,13-15,17,19,25-26,30-31,33H,4,7-12,16H2,1-3H3/t17-,19-,25+,26-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C29H37N3O3/c1-4-17-16-32-10-8-18-13-27(34-2)28(35-3)15-22(18)26(32)12-19(17)11-25-29-21(7-9-30-25)23-14-20(33)5-6-24(23)31-29/h5-6,13-15,17,19,25-26,30-31,33H,4,7-12,16H2,1-3H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 510 |
| By standard InChI | CHEMBL518568 |
|---|---|
| By standard InChI Main Layer | CHEMBL518568 CHEMBL535307 CHEMBL1254284 CHEMBL1369261 |
| By LinkDB | C09248 |
|---|
| By CAS RN | C009805 |
|---|
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL1369261 |
CHEMBL1614110
(1)
CHEMBL1741321
(1)
|
1 / 0 |
| Q16637 | Survival motor neuron protein | Unclassified protein | CHEMBL1369261 |
CHEMBL1613842
(1)
|
4 / 2 |
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL535307 |
CHEMBL2114784
(1)
|
1 / 1 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL1369261 |
CHEMBL1741325
(1)
|
0 / 1 |
| Q16665 | Hypoxia-inducible factor 1-alpha | Transcription Factor | CHEMBL1369261 |
CHEMBL1614456
(1)
CHEMBL1613803
(1)
|
0 / 0 |
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL535307 |
CHEMBL1794584
(1)
|
2 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL535307 |
CHEMBL2114780
(1)
|
0 / 0 |
| P63092 | Guanine nucleotide-binding protein G(s) subunit alpha isoforms short | Other membrane protein | CHEMBL535307 |
CHEMBL2114810
(1)
|
7 / 3 |
| P18433 | Receptor-type tyrosine-protein phosphatase alpha | Receptor tyrosine-protein phosphatase | CHEMBL1254284 |
CHEMBL1252117
(1)
CHEMBL1252118
(1)
|
0 / 0 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL1369261 |
CHEMBL1741322
(1)
|
0 / 0 |
| P23467 | Receptor-type tyrosine-protein phosphatase beta | Receptor tyrosine-protein phosphatase | CHEMBL1254284 |
CHEMBL1252119
(1)
|
0 / 0 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL1369261 |
CHEMBL1741323
(1)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1369261 |
CHEMBL1741324
(1)
|
0 / 1 |
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL535307 |
CHEMBL1737991
(1)
|
0 / 0 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL535307 |
CHEMBL1738184
(1)
|
0 / 0 |
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL535307 |
CHEMBL2354311
(1)
|
1 / 0 |
| O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL535307 |
CHEMBL2114738
(1)
|
0 / 0 |
| Q9H0H5 | Rac GTPase-activating protein 1 | Unclassified protein | CHEMBL535307 |
CHEMBL2114881
(1)
|
0 / 0 |
| Q06710 | Paired box protein Pax-8 | Unclassified protein | CHEMBL535307 |
CHEMBL2354301
(1)
|
1 / 2 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #219080 | Acth-independent macronodular adrenal hyperplasia; aimah |
P63092
|
| #114500 | Colorectal cancer; crc |
P84022
|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #137800 | Glioma susceptibility 1; glm1 |
O75874
|
| #218700 | Hypothyroidism, congenital, nongoitrous, 2; chng2 |
Q06710
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|
| #174800 | Mccune-albright syndrome; mas |
P63092
|
| #166350 | Osseous heteroplasia, progressive; poh |
P63092
|
| #102200 | Pituitary adenoma, growth hormone-secreting |
P63092
|
| #103580 | Pseudohypoparathyroidism, type ia; php1a |
P63092
|
| #603233 | Pseudohypoparathyroidism, type ib; php1b |
P63092
|
| #612462 | Pseudohypoparathyroidism, type ic; php1c |
P63092
|
| #253300 | Spinal muscular atrophy, type i; sma1 |
Q16637
|
| #253550 | Spinal muscular atrophy, type ii; sma2 |
Q16637
|
| #253400 | Spinal muscular atrophy, type iii; sma3 |
Q16637
|
| #271150 | Spinal muscular atrophy, type iv; sma4 |
Q16637
|
| #183090 | Spinocerebellar ataxia 2; sca2 |
Q99700
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|
| H00244 | Pseudohypoparathyroidism |
P63092
(related)
|
| H00441 | Progressive osseous heteroplasia (POH) |
P63092
(related)
|
| H00501 | Fibrous dysplasia, polyostotic |
P63092
(related)
|
| H00032 | Thyroid cancer |
Q06710
(related)
|
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) |
Q06710
(related)
|
| H00455 | Spinal muscular atrophy (SMA) |
Q16637
(related)
Q16637 (related) |
| H00063 | Spinocerebellar ataxia (SCA) |
Q99700
(related)
|