| id | C00001867 |
|---|---|
| Name | alpha-Hydrastine / (-)-alpha-Hydrastine |
| CAS RN | 4370-85-8 |
| Standard InChI | InChI=1S/C21H21NO6/c1-22-7-6-11-8-15-16(27-10-26-15)9-13(11)18(22)19-12-4-5-14(24-2)20(25-3)17(12)21(23)28-19/h4-5,8-9,18-19H,6-7,10H2,1-3H3/t18-,19-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H21NO6/c1-22-7-6-11-8-15-16(27-10-26-15)9-13(11)18(22)19-12-4-5-14(24-2)20(25-3)17(12)21(23)28-19/h4-5,8-9,18-19H,6-7,10H2,1-3H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 605 |
| By standard InChI | CHEMBL475536 |
|---|---|
| By standard InChI Main Layer | CHEMBL475536 CHEMBL462731 CHEMBL1256868 CHEMBL1256919 CHEMBL1408680 CHEMBL1412842 CHEMBL1441048 |
| By LinkDB | C09462 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 3 |
| family name | count |
|---|---|
| Papaveraceae | 2 |
| Ranunculaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Corydalis solida | 38914 | Papaveraceae | eudicotyledons | Viridiplantae |
| Fumaria parviflora | 200992 | Papaveraceae | eudicotyledons | Viridiplantae |
| Hydrastis canadensis | 13569 | Ranunculaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL475536 CHEMBL1256919 |
CHEMBL1614110
(1)
CHEMBL1741321
(2)
CHEMBL1743404 (1) |
1 / 0 |
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL475536 |
CHEMBL2114784
(1)
|
1 / 1 |
| Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL1256868 |
CHEMBL1794573
(1)
|
2 / 2 |
| P04062 | Glucosylceramidase | Enzyme | CHEMBL1256868 |
CHEMBL1613818
(1)
|
6 / 4 |
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL1408680 |
CHEMBL1614544
(1)
|
11 / 10 |
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL475536 |
CHEMBL1614281
(1)
CHEMBL1614361
(2)
|
3 / 2 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL475536 CHEMBL1256919 |
CHEMBL1614027
(4)
CHEMBL1741325
(2)
CHEMBL1743400 (1) |
0 / 1 |
| P54132 | Bloom syndrome protein | Enzyme | CHEMBL1408680 |
CHEMBL1614522
(1)
CHEMBL1614067
(1)
|
1 / 2 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL475536 CHEMBL1256868 |
CHEMBL1738606
(2)
|
0 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL1256868 |
CHEMBL2114843
(1)
|
0 / 0 |
| P04150 | Glucocorticoid receptor | NR3C1 | CHEMBL475536 |
CHEMBL960411
(1)
|
0 / 1 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL475536 |
CHEMBL1741322
(2)
|
0 / 0 |
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL1256868 CHEMBL1408680 |
CHEMBL1613910
(2)
|
3 / 3 |
| Q01453 | Peripheral myelin protein 22 | Unclassified protein | CHEMBL1412842 |
CHEMBL1614171
(1)
|
5 / 2 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1256868 |
CHEMBL1738588
(1)
|
0 / 0 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL475536 CHEMBL1256919 |
CHEMBL1613777
(4)
CHEMBL1741323
(2)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL475536 CHEMBL462731 CHEMBL1256868 CHEMBL1256919 CHEMBL1408680 |
CHEMBL1614108
(5)
CHEMBL1613886
(5)
CHEMBL1741324 (2) CHEMBL1743471 (2) |
0 / 1 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1256868 |
CHEMBL1794483
(1)
|
0 / 0 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL1256868 |
CHEMBL1613914
(1)
|
0 / 0 |
| P40225 | Thrombopoietin | Unclassified protein | CHEMBL475536 |
CHEMBL1614086
(1)
CHEMBL1614034
(1)
|
1 / 1 |
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL1408680 |
CHEMBL1738442
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #300438 | 17-beta-hydroxysteroid dehydrogenase x deficiency |
Q99714
|
| #210900 | Bloom syndrome; blm |
P54132
|
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a |
P02545
|
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism |
P02545
|
| #118300 | Charcot-marie-tooth disease and deafness |
Q01453
|
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 |
P02545
|
| #118220 | Charcot-marie-tooth disease, demyelinating, type 1a; cmt1a |
Q01453
|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 |
P02545
|
| #608013 | Gaucher disease, perinatal lethal |
P04062
|
| #230800 | Gaucher disease, type i |
P04062
|
| #230900 | Gaucher disease, type ii |
P04062
|
| #231000 | Gaucher disease, type iii |
P04062
|
| #231005 | Gaucher disease, type iiic |
P04062
|
| #139393 | Guillain-barre syndrome, familial; gbs |
Q01453
|
| #610140 | Heart-hand syndrome, slovenian type |
P02545
|
| #176670 | Hutchinson-gilford progeria syndrome; hgps |
P02545
|
| #603373 | Hyperthyroidism, familial gestational |
P16473
|
| #609152 | Hyperthyroidism, nonautoimmune |
P16473
|
| #145900 | Hypertrophic neuropathy of dejerine-sottas |
Q01453
|
| #275200 | Hypothyroidism, congenital, nongoitrous, 1; chng1 |
P16473
|
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 |
P02545
|
| #613688 | Long qt syndrome 2; lqt2 |
Q12809
|
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada |
P02545
|
| #300705 | Mental retardation, x-linked 17; mrx17 |
Q99714
|
| #300220 | Mental retardation, x-linked, syndromic 10; mrxs10 |
Q99714
|
| #613205 | Muscular dystrophy, congenital, lmna-related |
P02545
|
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b |
P02545
|
| #162500 | Neuropathy, hereditary, with liability to pressure palsies; hnpp |
Q01453
|
| #168600 | Parkinson disease, late-onset; pd |
P04062
|
| #275210 | Restrictive dermopathy, lethal |
P02545
|
| #609620 | Short qt syndrome 1; sqt1 |
Q12809
|
| #183090 | Spinocerebellar ataxia 2; sca2 |
Q99700
|
| #187950 | Thrombocythemia 1; thcyt1 |
P40225
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00264 | Charcot-Marie-Tooth disease (CMT) |
P02545
(related)
Q01453 (related) |
| H00294 | Dilated cardiomyopathy (DCM) |
P02545
(related)
|
| H00420 | Familial partial lipodystrophy (FPL) |
P02545
(related)
|
| H00563 | Emery-Dreifuss muscular dystrophy |
P02545
(related)
|
| H00590 | Congenital muscular dystrophies (CMD/MDC) |
P02545
(related)
|
| H00593 | Limb-girdle muscular dystrophy (LGMD) |
P02545
(related)
|
| H00601 | Hutchinson-Gilford progeria syndrome |
P02545
(related)
|
| H00663 | Restrictive dermopathy |
P02545
(related)
|
| H00665 | Mandibuloacral dysplasia |
P02545
(related)
|
| H01216 | Left ventricular noncompaction (LVNC) |
P02545
(related)
|
| H00066 | Lewy body dementia (LBD) |
P04062
(related)
|
| H00126 | Gaucher disease |
P04062
(related)
|
| H00426 | Defects in the degradation of ganglioside |
P04062
(related)
|
| H00810 | Progressive myoclonic epilepsy (PME) |
P04062
(related)
|
| H00599 | 46,XX disorders of sex development (Disorders related to androgen excess) |
P04150
(related)
|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) |
P16473
(related)
|
| H01269 | Congenital hyperthyroidism |
P16473
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|
| H00227 | Congenital amegakaryocytic thrombocytopenia (CAMT) |
P40225
(marker)
|
| H00094 | DNA repair defects |
P54132
(related)
|
| H00296 | Defects in RecQ helicases |
P54132
(related)
|
| H01296 | Hereditary neuropathy with liability to pressure palsies (HNPP) |
Q01453
(related)
|
| H00720 | Long QT syndrome |
Q12809
(related)
|
| H00725 | Short QT syndrome |
Q12809
(related)
|
| H00063 | Spinocerebellar ataxia (SCA) |
Q99700
(related)
|
| H00480 | Non-syndromic X-linked mental retardation |
Q99714
(related)
|
| H00658 | Syndromic X-linked mental retardation |
Q99714
(related)
|
| H00925 | 2-Methyl-3-hydroxybutyryl-CoA dehydrogenase (MHBD) deficiency |
Q99714
(related)
|