| id | C00001897 |
|---|---|
| Name | Oxyacanthine |
| CAS RN | 548-40-3 |
| Standard InChI | InChI=1S/C37H40N2O6/c1-38-14-12-24-19-32(41-3)33-21-27(24)28(38)17-23-8-11-30(40)31(18-23)44-26-9-6-22(7-10-26)16-29-35-25(13-15-39(29)2)20-34(42-4)36(43-5)37(35)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3/t28-,29+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C37H40N2O6/c1-38-14-12-24-19-32(41-3)33-21-27(24)28(38)17-23-8-11-30(40)31(18-23)44-26-9-6-22(7-10-26)16-29-35-25(13-15-39(29)2)20-34(42-4)36(43-5)37(35)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 10 |
| By standard InChI | CHEMBL509999 |
|---|---|
| By standard InChI Main Layer | CHEMBL510022 CHEMBL509999 CHEMBL1983122 |
| By LinkDB | C09598 |
|---|
| By CAS RN | C092646 |
|---|
| class name | count |
|---|---|
| eudicotyledons | 18 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Berberidaceae | 17 |
| Lauraceae | 1 |
| Ranunculaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL509999 |
CHEMBL2114784
(1)
|
1 / 1 |
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL509999 |
CHEMBL1794584
(1)
|
2 / 0 |
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL509999 |
CHEMBL1737991
(1)
|
0 / 0 |
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL509999 |
CHEMBL2354311
(1)
|
1 / 0 |
| P43351 | DNA repair protein RAD52 homolog | Unclassified protein | CHEMBL509999 |
CHEMBL2354285
(1)
|
0 / 0 |