| id | C00001907 |
|---|---|
| Name | Psychotrine |
| CAS RN | 7633-29-6 |
| Standard InChI | InChI=1S/C28H36N2O4/c1-5-17-16-30-9-7-19-13-27(33-3)28(34-4)15-22(19)24(30)11-20(17)10-23-21-14-26(32-2)25(31)12-18(21)6-8-29-23/h12-15,17,20,24,31H,5-11,16H2,1-4H3/t17-,20-,24-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C28H36N2O4/c1-5-17-16-30-9-7-19-13-27(33-3)28(34-4)15-22(19)24(30)11-20(17)10-23-21-14-26(32-2)25(31)12-18(21)6-8-29-23/h12-15,17,20,24,31H,5-11,16H2,1-4H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 510 |
| By standard InChI | CHEMBL463445 |
|---|---|
| By standard InChI Main Layer | CHEMBL463445 |
| By LinkDB | C09612 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alangium lamarckii | 16896 | Cornaceae | asterids | Viridiplantae |
| Cephaelis acuminata | 77880 | Rubiaceae | asterids | Viridiplantae |
| Cephaelis ipecacuanha | 77880 | Rubiaceae | asterids | Viridiplantae |
| Pogonopus speciosus | 43555 | Rubiaceae | asterids | Viridiplantae |