| id | C00019698 |
|---|---|
| Name | Thymidine / Deoxythymidine |
| CAS RN | 50-89-5 |
| Standard InChI | InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6?,7-,8-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4547 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL6497 CHEMBL42372 CHEMBL52609 CHEMBL211174 CHEMBL374731 CHEMBL2067985 |
| By LinkDB | C00214 |
|---|
| By CAS RN | D013936 |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Axinellidae | 1 |
| Enterobacteriaceae | 1 |
| Orchidaceae | 1 |
| Subergorgiidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Escherichia coli | 562 | Enterobacteriaceae | Bacteria | |
| Gymnadenia conopsea R.BR. | 59323 | Orchidaceae | Liliopsida | Viridiplantae |
| Phakellia mauritiana | 85813 | Axinellidae | Metazoa | |
| Subergorgia suberosa | 767284 | Subergorgiidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P19971 | Thymidine phosphorylase | Enzyme | CHEMBL52609 |
CHEMBL813687
(1)
CHEMBL813689
(1)
|
1 / 1 |
| P23919 | Thymidylate kinase | Enzyme | CHEMBL52609 |
CHEMBL919553
(1)
CHEMBL954908
(1)
|
0 / 0 |
| O15245 | Solute carrier family 22 member 1 | Drug uniporter | CHEMBL52609 |
CHEMBL2077759
(1)
|
0 / 0 |
| P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL6497 |
CHEMBL1613776
(1)
|
3 / 1 |
| P04183 | Thymidine kinase, cytosolic | Enzyme | CHEMBL52609 |
CHEMBL690902
(1)
CHEMBL690904
(1)
CHEMBL812339 (1) CHEMBL858388 (1) CHEMBL812345 (1) CHEMBL882127 (1) CHEMBL816080 (1) CHEMBL816081 (1) CHEMBL816084 (1) CHEMBL816088 (1) CHEMBL858392 (1) CHEMBL816089 (1) CHEMBL814145 (1) CHEMBL814146 (1) CHEMBL812475 (1) CHEMBL819083 (1) CHEMBL819084 (1) CHEMBL819086 (1) CHEMBL858768 (1) CHEMBL819087 (1) CHEMBL819100 (1) CHEMBL819101 (1) CHEMBL815480 (1) CHEMBL858617 (1) CHEMBL858200 (1) CHEMBL844156 (1) CHEMBL844157 (1) CHEMBL868104 (1) CHEMBL1112804 (2) CHEMBL1112807 (1) |
0 / 1 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL52609 |
CHEMBL1614211
(1)
|
0 / 0 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| D013936 | 248 |
ALPI
IAP |
alkaline phosphatase, intestinal (EC:3.1.3.1) | Thymidine promotes the reaction [Methotrexate results in increased activity of ALPI protein] |
increases activity
/ increases reaction |
protein |
16598758
|
| D013936 | 581 |
BAX
BCL2L4 |
BCL2-associated X protein | Thymidine inhibits the reaction [Adenosine results in increased localization of BAX protein] |
decreases reaction
/ increases localization |
protein |
11570579
|
| D013936 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | Thymidine inhibits the reaction [Adenosine results in increased activity of CASP3 protein] |
decreases reaction
/ increases activity |
protein |
11570579
|
| D013936 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | Thymidine results in increased activity of CASP3 protein |
increases activity
|
protein |
16419169
|
| D013936 | 842 |
CASP9
APAF-3 APAF3 ICE-LAP6 MCH6 PPP1R56 |
caspase 9, apoptosis-related cysteine peptidase (EC:3.4.22.62) | Thymidine inhibits the reaction [Adenosine results in increased activity of CASP9 protein] |
decreases reaction
/ increases activity |
protein |
11570579
|
| D013936 | 1435 |
CSF1
CSF-1 MCSF |
colony stimulating factor 1 (macrophage) (EC:2.7.10.1) | CSF1 protein results in increased uptake of Thymidine |
increases uptake
|
protein |
8193360
|
| D013936 | 1906 |
EDN1
ET1 HDLCQ7 PPET1 |
endothelin 1 | EDN1 protein results in increased uptake of Thymidine |
increases uptake
|
protein |
10100047
|
| D013936 | 356 |
FASLG
ALPS1B APT1LG1 APTL CD178 CD95-L CD95L FASL TNFSF6 |
Fas ligand (TNF superfamily, member 6) | Thymidine results in increased expression of FASLG protein |
increases expression
|
protein |
16419169
|
| D013936 | 3091 |
HIF1A
HIF-1A HIF-1alpha HIF1 HIF1-ALPHA MOP1 PASD8 bHLHe78 |
hypoxia inducible factor 1, alpha subunit (basic helix-loop-helix transcription factor) | [Thymidine co-treated with TYMP co-treated with Oxygen deficiency] results in increased expression of HIF1A protein |
affects cotreatment
/ increases expression |
protein |
15841086
|
| D013936 | 3162 |
HMOX1
HMOX1D HO-1 HSP32 bK286B10 |
heme oxygenase (decycling) 1 (EC:1.14.99.3) | Acetylcysteine inhibits the reaction [[TYMP protein co-treated with Thymidine] results in increased expression of HMOX1 protein] |
affects cotreatment
/ decreases reaction / increases expression |
protein |
11103787
|
| D013936 | 3162 |
HMOX1
HMOX1D HO-1 HSP32 bK286B10 |
heme oxygenase (decycling) 1 (EC:1.14.99.3) | [Thymidine co-treated with TYMP protein] results in increased expression of HMOX1 protein |
affects cotreatment
/ increases expression |
protein |
15841086
|
| D013936 | 3162 |
HMOX1
HMOX1D HO-1 HSP32 bK286B10 |
heme oxygenase (decycling) 1 (EC:1.14.99.3) | Thymine inhibits the reaction [[TYMP protein co-treated with Thymidine] results in increased expression of HMOX1 protein] |
affects cotreatment
/ decreases reaction / increases expression |
protein |
11103787
|
| D013936 | 3162 |
HMOX1
HMOX1D HO-1 HSP32 bK286B10 |
heme oxygenase (decycling) 1 (EC:1.14.99.3) | [TYMP protein co-treated with Thymidine] results in increased expression of HMOX1 protein |
affects cotreatment
/ increases expression |
protein |
11103787
|
| D013936 | 3479 |
IGF1
IGF-I IGF1A IGFI |
insulin-like growth factor 1 (somatomedin C) | IGF1 protein results in decreased uptake of Thymidine |
decreases uptake
|
protein |
1332906
|
| D013936 | 3479 |
IGF1
IGF-I IGF1A IGFI |
insulin-like growth factor 1 (somatomedin C) | [Tetrachlorodibenzodioxin co-treated with Estradiol] inhibits the reaction [IGF1 protein results in increased uptake of Thymidine] |
affects cotreatment
/ decreases reaction / increases uptake |
protein |
1332906
|
| D013936 | 3479 |
IGF1
IGF-I IGF1A IGFI |
insulin-like growth factor 1 (somatomedin C) | Tetrachlorodibenzodioxin inhibits the reaction [IGF1 protein results in decreased uptake of Thymidine] |
decreases reaction
/ decreases uptake |
protein |
1332906
|
| D013936 | 3576 |
IL8
CXCL8 GCP-1 GCP1 LECT LUCT LYNAP MDNCF MONAP NAF NAP-1 NAP1 |
interleukin 8 | [Thymidine co-treated with TYMP protein] results in increased secretion of IL8 protein |
affects cotreatment
/ increases secretion |
protein |
11103787
|
| D013936 | 3576 |
IL8
CXCL8 GCP-1 GCP1 LECT LUCT LYNAP MDNCF MONAP NAF NAP-1 NAP1 |
interleukin 8 | Thymine inhibits the reaction [[Thymidine co-treated with TYMP protein] results in increased secretion of IL8 protein] |
affects cotreatment
/ decreases reaction / increases secretion |
protein |
11103787
|
| D013936 | 4312 |
MMP1
CLG CLGN |
matrix metallopeptidase 1 (interstitial collagenase) (EC:3.4.24.7) | [Thymidine co-treated with TYMP protein] results in increased expression of MMP1 protein |
affects cotreatment
/ increases expression |
protein |
11103787
|
| D013936 | 4312 |
MMP1
CLG CLGN |
matrix metallopeptidase 1 (interstitial collagenase) (EC:3.4.24.7) | Thymine inhibits the reaction [[Thymidine co-treated with TYMP protein] results in increased expression of MMP1 protein] |
affects cotreatment
/ decreases reaction / increases expression |
protein |
11103787
|
| D013936 | 4548 |
MTR
HMAG MS cblG |
5-methyltetrahydrofolate-homocysteine methyltransferase (EC:2.1.1.13) | [Thymidine co-treated with Hypoxanthine co-treated with 5,6,7,8-tetrahydrofolic acid] inhibits the reaction [Methotrexate results in decreased expression of MTR protein] |
affects cotreatment
/ decreases expression / decreases reaction |
protein |
16598758
|
| D013936 | 4548 |
MTR
HMAG MS cblG |
5-methyltetrahydrofolate-homocysteine methyltransferase (EC:2.1.1.13) | [Thymidine co-treated with Hypoxanthine] inhibits the reaction [Methotrexate results in decreased expression of MTR protein] |
affects cotreatment
/ decreases expression / decreases reaction |
protein |
16598758
|
| D013936 | 4609 |
MYC
MRTL MYCC bHLHe39 c-Myc |
v-myc avian myelocytomatosis viral oncogene homolog | Thymidine inhibits the reaction [Adenosine results in decreased expression of MYC protein] |
decreases expression
/ decreases reaction |
protein |
9808420
|
| D013936 | 9154 |
SLC28A1
CNT1 HCNT1 |
solute carrier family 28 (concentrative nucleoside transporter), member 1 | Thymidine inhibits the reaction [SLC28A1 protein results in increased uptake of Uridine] |
decreases reaction
/ increases uptake |
protein |
9124315
|
| D013936 | 1890 |
TYMP
ECGF ECGF1 MEDPS1 MNGIE MTDPS1 PDECGF TP hPD-ECGF |
thymidine phosphorylase (EC:2.4.2.4) | Acetylcysteine inhibits the reaction [[TYMP protein co-treated with Thymidine] results in increased expression of HMOX1 protein] |
affects cotreatment
/ decreases reaction / increases expression |
protein |
11103787
|
| D013936 | 1890 |
TYMP
ECGF ECGF1 MEDPS1 MNGIE MTDPS1 PDECGF TP hPD-ECGF |
thymidine phosphorylase (EC:2.4.2.4) | [Thymidine co-treated with TYMP co-treated with Oxygen deficiency] results in increased expression of HIF1A protein |
affects cotreatment
/ increases expression |
15841086
|
|
| D013936 | 1890 |
TYMP
ECGF ECGF1 MEDPS1 MNGIE MTDPS1 PDECGF TP hPD-ECGF |
thymidine phosphorylase (EC:2.4.2.4) | [Thymidine co-treated with TYMP protein] results in increased expression of HMOX1 protein |
affects cotreatment
/ increases expression |
protein |
15841086
|
| D013936 | 1890 |
TYMP
ECGF ECGF1 MEDPS1 MNGIE MTDPS1 PDECGF TP hPD-ECGF |
thymidine phosphorylase (EC:2.4.2.4) | [Thymidine co-treated with TYMP protein] results in increased expression of MMP1 protein |
affects cotreatment
/ increases expression |
protein |
11103787
|
| D013936 | 1890 |
TYMP
ECGF ECGF1 MEDPS1 MNGIE MTDPS1 PDECGF TP hPD-ECGF |
thymidine phosphorylase (EC:2.4.2.4) | [Thymidine co-treated with TYMP protein] results in increased secretion of IL8 protein |
affects cotreatment
/ increases secretion |
protein |
11103787
|
| D013936 | 1890 |
TYMP
ECGF ECGF1 MEDPS1 MNGIE MTDPS1 PDECGF TP hPD-ECGF |
thymidine phosphorylase (EC:2.4.2.4) | Thymine inhibits the reaction [[Thymidine co-treated with TYMP protein] results in increased expression of MMP1 protein] |
affects cotreatment
/ decreases reaction / increases expression |
protein |
11103787
|
| D013936 | 1890 |
TYMP
ECGF ECGF1 MEDPS1 MNGIE MTDPS1 PDECGF TP hPD-ECGF |
thymidine phosphorylase (EC:2.4.2.4) | Thymine inhibits the reaction [[Thymidine co-treated with TYMP protein] results in increased secretion of IL8 protein] |
affects cotreatment
/ decreases reaction / increases secretion |
protein |
11103787
|
| D013936 | 1890 |
TYMP
ECGF ECGF1 MEDPS1 MNGIE MTDPS1 PDECGF TP hPD-ECGF |
thymidine phosphorylase (EC:2.4.2.4) | Thymine inhibits the reaction [[TYMP protein co-treated with Thymidine] results in increased expression of HMOX1 protein] |
affects cotreatment
/ decreases reaction / increases expression |
protein |
11103787
|
| D013936 | 1890 |
TYMP
ECGF ECGF1 MEDPS1 MNGIE MTDPS1 PDECGF TP hPD-ECGF |
thymidine phosphorylase (EC:2.4.2.4) | [TYMP protein co-treated with Thymidine] results in increased expression of HMOX1 protein |
affects cotreatment
/ increases expression |
protein |
11103787
|
| D013936 | 1890 |
TYMP
ECGF ECGF1 MEDPS1 MNGIE MTDPS1 PDECGF TP hPD-ECGF |
thymidine phosphorylase (EC:2.4.2.4) | TYMP protein results in increased phosphorylation of Thymidine |
increases phosphorylation
|
protein |
11103787
|
| OMIM | preferred title | UniProt |
|---|---|---|
| #603041 | Mitochondrial dna depletion syndrome 1 (mngie type); mtdps1 |
P19971
|
| #188570 | Thyroid hormone resistance, generalized, autosomal dominant; grth |
P10828
|
| #274300 | Thyroid hormone resistance, generalized, autosomal recessive; grth |
P10828
|
| #145650 | Thyroid hormone resistance, selective pituitary; prth |
P10828
|
| MeSH disease | OMIM | compound | disease name | evidence type |
reference
pmid |
|---|---|---|---|---|---|
| D058186 | D013936 | Acute Kidney Injury |
therapeutic
|
1838364
|
|
| D001927 | D013936 | Brain Diseases |
therapeutic
|
9816193
|
|
| D015179 | D013936 | Colorectal Neoplasms |
therapeutic
|
6491697
|
|
| D003128 | D013936 | COMA |
therapeutic
|
9816193
|
|
| D064420 | D013936 | Drug-Related Side Effects and Adverse Reactions |
marker/mechanism
therapeutic |
1838364
6607976 10206466 11459208 14581433 |
|
| D005076 | D013936 | Exanthema |
therapeutic
|
6607976
|
|
| D007970 | D013936 | Leukopenia |
marker/mechanism
therapeutic |
6491697
6607976 |
|
| D008114 | D013936 | Liver Neoplasms, Experimental |
marker/mechanism
|
6145526
|
|
| D052016 | D013936 | Mucositis |
therapeutic
|
6607976
|
|
| D009336 | D013936 | Necrosis |
therapeutic
|
4049281
|
|
| D009436 | D013936 | Neural Tube Defects |
therapeutic
|
4049281
|
|
| D009461 | D013936 | Neurologic Manifestations |
marker/mechanism
|
6491697
|
|
| D011297 | D013936 | Prenatal Exposure Delayed Effects |
therapeutic
|
4049281
|
|
| D051437 | D013936 | Renal Insufficiency |
therapeutic
|
9164227
|
|
| D013280 | D013936 | Stomatitis |
therapeutic
|
6607976
|
|
| D013921 | D013936 | Thrombocytopenia |
therapeutic
|
6607976
|