| id | C00002035 |
|---|---|
| Name | 1-Deoxymannojirimycin / (-)-Deoxymannojirimycin |
| CAS RN | 84444-90-6 |
| Standard InChI | InChI=1S/C6H13NO4/c8-2-3-5(10)6(11)4(9)1-7-3/h3-11H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C6H13NO4/c8-2-3-5(10)6(11)4(9)1-7-3/h3-11H,1-2H2 |
| Phytochemical cluster | No. 1 |
|---|---|
| KCF-S cluster | No. 786 |
| By standard InChI | CHEMBL84844 |
|---|---|
| By standard InChI Main Layer | CHEMBL11510 CHEMBL65131 CHEMBL307429 CHEMBL84844 CHEMBL110458 CHEMBL369297 CHEMBL179085 CHEMBL176206 CHEMBL179130 CHEMBL179347 CHEMBL179409 CHEMBL176021 CHEMBL369046 CHEMBL176209 CHEMBL368121 CHEMBL175901 CHEMBL1337303 |
| By LinkDB | C10141 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 8 |
| asterids | 1 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Fabaceae | 5 |
| Euphorbiaceae | 2 |
| Campanulaceae | 1 |
| Connaraceae | 1 |
| Hyacinthaceae | 1 |
| Streptomycetaceae | 1 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #301500 | Fabry disease |
P06280
|
| #230000 | Fucosidosis |
P04066
|
| #608013 | Gaucher disease, perinatal lethal |
P04062
|
| #230800 | Gaucher disease, type i |
P04062
|
| #230900 | Gaucher disease, type ii |
P04062
|
| #231000 | Gaucher disease, type iii |
P04062
|
| #231005 | Gaucher disease, type iiic |
P04062
|
| #232300 | Glycogen storage disease ii |
P10253
|
| #232400 | Glycogen storage disease iii |
P35573
|
| #230500 | Gm1-gangliosidosis, type i |
P16278
|
| #230600 | Gm1-gangliosidosis, type ii |
P16278
|
| #230650 | Gm1-gangliosidosis, type iii |
P16278
|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #223000 | Lactase deficiency, congenital |
P09848
|
| #248500 | Mannosidosis, alpha b, lysosomal; mansa |
O00754
|
| #248510 | Mannosidosis, beta a, lysosomal; mansb |
O00462
|
| #253010 | Mucopolysaccharidosis type ivb |
P16278
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| #168600 | Parkinson disease, late-onset; pd |
P04062
|
| #614409 | Spastic paraplegia 46, autosomal recessive; spg46 |
Q9HCG7
|
| #222900 | Sucrase-isomaltase deficiency, congenital; csid |
P14410
|
| #188570 | Thyroid hormone resistance, generalized, autosomal dominant; grth |
P10828
|
| #274300 | Thyroid hormone resistance, generalized, autosomal recessive; grth |
P10828
|
| #145650 | Thyroid hormone resistance, selective pituitary; prth |
P10828
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
|
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00140 | beta-Mannosidosis |
O00462
(related)
|
| H00422 | Glycoproteinoses |
O00462
(related)
O00754 (related) P04066 (related) P16278 (related) |
| H00139 | alpha-Mannosidosis |
O00754
(related)
|
| H00066 | Lewy body dementia (LBD) |
P04062
(related)
|
| H00126 | Gaucher disease |
P04062
(related)
|
| H00426 | Defects in the degradation of ganglioside |
P04062
(related)
P16278 (related) |
| H00810 | Progressive myoclonic epilepsy (PME) |
P04062
(related)
|
| H00141 | Fucosidosis |
P04066
(related)
|
| H00125 | Fabry disease |
P06280
(related)
|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H00116 | Congenital lactase deficiency |
P09848
(related)
|
| H00069 | Glycogen storage diseases (GSD) |
P10253
(related)
P35573 (related) |
| H00249 | Thyroid hormone resistance syndrome |
P10828
(related)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H00115 | Congenital sucrase-isomaltase deficiency |
P14410
(related)
|
| H00123 | Mucopolysaccharidosis type IV (MPS4) |
P16278
(related)
|
| H00276 | Galactosialidosis |
P16278
(related)
|
| H00281 | GM1 gangliosidosis |
P16278
(related)
|
| H00421 | Mucopolysaccharidosis (MPS) |
P16278
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q03164
(related)
Q03164 (marker) |
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|