id | C00021671 |
---|---|
Name | Aristolochic acid B / Aristolochic acid II |
CAS RN | 475-80-9 |
Standard InChI | InChI=1S/C16H9NO6/c18-16(19)10-6-12-15(23-7-22-12)14-9-4-2-1-3-8(9)5-11(13(10)14)17(20)21/h1-6H,7H2,(H,18,19) |
Standard InChI (Main Layer) | InChI=1S/C16H9NO6/c18-16(19)10-6-12-15(23-7-22-12)14-9-4-2-1-3-8(9)5-11(13(10)14)17(20)21/h1-6H,7H2,(H,18,19) |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 291 |
By standard InChI | CHEMBL602280 |
---|---|
By standard InChI Main Layer | CHEMBL602280 |
By LinkDB |
---|
By CAS RN | C042310 |
---|
class name | count |
---|---|
Magnoliophyta | 4 |
family name | count |
---|---|
Aristolochiaceae | 4 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P24941 | Cyclin-dependent kinase 2 | Cdc2 | CHEMBL602280 |
CHEMBL1067148
(1)
CHEMBL1067154
(1)
|
0 / 0 |