| id | C00002173 | 
|---|---|
| Name | Hydroquinidine | 
| CAS RN | 1435-55-8 | 
| Standard InChI | InChI=1S/C20H26N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h4-6,8,11,13-14,19-20,23H,3,7,9-10,12H2,1-2H3/t13-,14-,19+,20-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C20H26N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h4-6,8,11,13-14,19-20,23H,3,7,9-10,12H2,1-2H3 | 
| Phytochemical cluster | No. 7 | 
|---|---|
| KCF-S cluster | No. 1378 | 
| By standard InChI | CHEMBL531472 | 
|---|---|
| By standard InChI Main Layer | CHEMBL531471 CHEMBL531472 CHEMBL588934 CHEMBL602767 CHEMBL1436416 CHEMBL1531111 CHEMBL1617471 CHEMBL1740727 CHEMBL1906890 CHEMBL2079611 CHEMBL2092739 CHEMBL2305514 CHEMBL2355802 | 
| By LinkDB | C10696 | 
|---|
| By CAS RN | C014486 | 
|---|
| class name | count | 
|---|---|
| asterids | 3 | 
| family name | count | 
|---|---|
| Rubiaceae | 2 | 
| Apocynaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Aspidosperma marcgravianum | 597276 | Apocynaceae | asterids | Viridiplantae | 
| Cinchona officinalis | 273781 | Rubiaceae | asterids | Viridiplantae | 
| Remijia pedunculata | 273807 | Rubiaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL1531111 CHEMBL2079611 CHEMBL2092739 | CHEMBL729206
                        (2)
                        CHEMBL1614110
                        (1) | 1 / 0 | 
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL1531111 | CHEMBL1614281
                        (1)
                        CHEMBL1614361
                        (1) | 3 / 2 | 
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1436416 CHEMBL2092739 | CHEMBL1614458
                        (2) | 0 / 0 | 
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL1436416 CHEMBL2092739 | CHEMBL1613910
                        (2) | 3 / 3 | 
| P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD(+)] | Enzyme | CHEMBL1436416 CHEMBL2092739 | CHEMBL1614038
                        (2) | 2 / 2 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1436416 | CHEMBL1614108
                        (1)
                        CHEMBL1613886
                        (1) | 0 / 1 | 
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL1436416 CHEMBL2092739 | CHEMBL1613914
                        (2) | 0 / 0 | 
| O00255 | Menin | Unclassified protein | CHEMBL1436416 | CHEMBL1614531
                        (1) | 2 / 5 | 
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL1436416 | CHEMBL1614531
                        (1) | 1 / 3 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #300438 | 17-beta-hydroxysteroid dehydrogenase x deficiency | Q99714 | 
| #119900 | Digital clubbing, isolated congenital | P15428 | 
| #608902 | Drug metabolism, poor, cyp2d6-related | P10635 | 
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay | Q03164 | 
| #145000 | Hyperparathyroidism 1; hrpt1 | O00255 | 
| #603373 | Hyperthyroidism, familial gestational | P16473 | 
| #609152 | Hyperthyroidism, nonautoimmune | P16473 | 
| #259100 | Hypertrophic osteoarthropathy, primary, autosomal recessive, 1; phoar1 | P15428 | 
| #275200 | Hypothyroidism, congenital, nongoitrous, 1; chng1 | P16473 | 
| #300705 | Mental retardation, x-linked 17; mrx17 | Q99714 | 
| #300220 | Mental retardation, x-linked, syndromic 10; mrxs10 | Q99714 | 
| #131100 | Multiple endocrine neoplasia, type i; men1 | O00255 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00033 | Adrenal carcinoma | O00255
                            (related) | 
| H00034 | Carcinoid | O00255
                            (related) | 
| H00045 | Malignant islet cell carcinoma | O00255
                            (related) | 
| H00246 | Primary hyperparathyroidism | O00255
                            (related) | 
| H01102 | Pituitary adenomas | O00255
                            (related) | 
| H00036 | Osteosarcoma | P08684
                            (marker) | 
| H00457 | Primary hypertrophic osteoarthropathy (PHO) | P15428
                            (related) | 
| H01246 | Isolated congenital nail clubbing (ICNC) | P15428
                            (related) | 
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) | P16473
                            (related) | 
| H01269 | Congenital hyperthyroidism | P16473
                            (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q03164
                            (related) Q03164 (marker) | 
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) | Q03164
                            (related) | 
| H00480 | Non-syndromic X-linked mental retardation | Q99714
                            (related) | 
| H00658 | Syndromic X-linked mental retardation | Q99714
                            (related) | 
| H00925 | 2-Methyl-3-hydroxybutyryl-CoA dehydrogenase (MHBD) deficiency | Q99714
                            (related) | 
| MeSH disease | OMIM | compound | disease name | evidence type | reference pmid | 
|---|---|---|---|---|---|
| D064420 | C014486 | Drug-Related Side Effects and Adverse Reactions | marker/mechanism | 12701389 | |
| D006099 | C014486 | Granuloma | marker/mechanism | 3732735 | |
| D006505 | C014486 | Hepatitis | marker/mechanism | 3732735 | |
| D007565 | C014486 | Jaundice | marker/mechanism | 3732735 |