| id | C00002191 | 
|---|---|
| Name | Peganine / Vasicine / (-)-Linarine / (-)-Peganine / (-)-Vasicine | 
| CAS RN | 6159-55-3 | 
| Standard InChI | InChI=1S/C11H12N2O/c14-10-5-6-13-7-8-3-1-2-4-9(8)12-11(10)13/h1-4,10,14H,5-7H2/t10-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C11H12N2O/c14-10-5-6-13-7-8-3-1-2-4-9(8)12-11(10)13/h1-4,10,14H,5-7H2 | 
| Phytochemical cluster | No. 7 | 
|---|---|
| KCF-S cluster | No. 2365 | 
| By standard InChI | CHEMBL1456364 | 
|---|---|
| By standard InChI Main Layer | CHEMBL1186527 CHEMBL1456364 CHEMBL2163791 | 
| By LinkDB | C10733 | 
|---|
| By CAS RN | C019592 | 
|---|
| family name | count | 
|---|---|
| Malvaceae | 2 | 
| Nitrariaceae | 2 | 
| Acanthaceae | 2 | 
| Fabaceae | 1 | 
| Brassicaceae | 1 | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL1456364 | CHEMBL1794311
                        (1) | 2 / 3 | 
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1456364 | CHEMBL1738606
                        (1) | 0 / 0 | 
| P06276 | Cholinesterase | Hydrolase | CHEMBL2163791 | CHEMBL2166019
                        (1) | 0 / 0 |