| id | C00002193 | 
|---|---|
| Name | Quinine | 
| CAS RN | 130-95-0 | 
| Standard InChI | InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19-,20+/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3 | 
| Phytochemical cluster | No. 7 | 
|---|---|
| KCF-S cluster | No. 1378 | 
| By standard InChI | CHEMBL170 | 
|---|---|
| By standard InChI Main Layer | CHEMBL97 CHEMBL15088 CHEMBL21578 CHEMBL1294 CHEMBL170 CHEMBL387326 CHEMBL407725 CHEMBL512340 CHEMBL522505 CHEMBL460606 CHEMBL601807 CHEMBL576997 CHEMBL1358565 CHEMBL1364159 CHEMBL1616938 CHEMBL1741006 CHEMBL1878119 CHEMBL2355467 | 
| By LinkDB | C06526 | 
|---|
| By CAS RN | D011803 | 
|---|
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL97 CHEMBL21578 CHEMBL387326 CHEMBL512340 CHEMBL601807 | CHEMBL663531
                        (2)
                        CHEMBL729201
                        (2) CHEMBL729206 (4) CHEMBL758056 (2) CHEMBL754768 (1) CHEMBL828928 (1) CHEMBL827154 (1) CHEMBL860948 (1) CHEMBL860702 (1) CHEMBL856833 (1) CHEMBL930258 (1) CHEMBL1002237 (1) CHEMBL971601 (1) CHEMBL1028886 (1) CHEMBL1028887 (1) CHEMBL956235 (1) CHEMBL970954 (1) CHEMBL989847 (1) CHEMBL1000806 (1) CHEMBL960164 (1) CHEMBL960165 (1) CHEMBL1614110 (3) CHEMBL1664606 (1) CHEMBL1669910 (1) CHEMBL1741321 (2) CHEMBL1743281 (1) CHEMBL1768376 (1) CHEMBL2071965 (1) | 1 / 0 | 
| Q9Y6L6 | Solute carrier organic anion transporter family member 1B1 | Electrochemical transporter | CHEMBL21578 CHEMBL387326 | CHEMBL2077604
                        (1)
                        CHEMBL2169429
                        (2) | 1 / 0 | 
| O15244 | Solute carrier family 22 member 2 | Drug uniporter | CHEMBL21578 CHEMBL387326 | CHEMBL1743168
                        (1)
                        CHEMBL2076311
                        (1) CHEMBL2076808 (1) CHEMBL2077781 (1) CHEMBL2077782 (1) CHEMBL2077813 (1) | 0 / 0 | 
| O94956 | Solute carrier organic anion transporter family member 2B1 | Unclassified protein | CHEMBL21578 CHEMBL387326 | CHEMBL2169431
                        (2) | 0 / 0 | 
| Q96FL8 | Multidrug and toxin extrusion protein 1 | Cation antiporter | CHEMBL21578 | CHEMBL1743174
                        (1)
                        CHEMBL2320305
                        (1) CHEMBL2320306 (1) | 0 / 0 | 
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL1294 CHEMBL522505 CHEMBL1358565 | CHEMBL1794367
                        (2)
                        CHEMBL2114784
                        (3) | 1 / 1 | 
| O95342 | Bile salt export pump | drug | CHEMBL21578 | CHEMBL2076226
                        (1) | 2 / 1 | 
| Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL21578 CHEMBL1294 | CHEMBL766814
                        (1)
                        CHEMBL829152
                        (1) CHEMBL954102 (1) CHEMBL1794573 (1) CHEMBL1817375 (1) | 2 / 2 | 
| O15245 | Solute carrier family 22 member 1 | Drug uniporter | CHEMBL21578 CHEMBL387326 | CHEMBL993349
                        (2)
                        CHEMBL994103
                        (2) CHEMBL1743171 (2) CHEMBL2076306 (1) CHEMBL2076307 (1) CHEMBL2076204 (1) CHEMBL2076233 (2) CHEMBL2077747 (1) CHEMBL2077760 (1) CHEMBL2077761 (1) | 0 / 0 | 
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL387326 | CHEMBL2354282
                        (1) | 4 / 2 | 
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL97 CHEMBL1294 | CHEMBL1614281
                        (1)
                        CHEMBL1614361
                        (2) | 3 / 2 | 
| P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL387326 | CHEMBL1613776
                        (1) | 3 / 1 | 
| P02768 | Serum albumin | Secreted protein | CHEMBL21578 CHEMBL387326 | CHEMBL646315
                        (1)
                        CHEMBL702885
                        (2) CHEMBL925737 (1) | 0 / 0 | 
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL21578 CHEMBL387326 | CHEMBL754774
                        (1)
                        CHEMBL755181
                        (2) CHEMBL753510 (2) CHEMBL753511 (2) CHEMBL755826 (1) CHEMBL755827 (1) CHEMBL754160 (1) CHEMBL754161 (1) CHEMBL1743176 (1) CHEMBL1908285 (1) CHEMBL1908286 (1) CHEMBL1908289 (1) CHEMBL1908291 (1) CHEMBL1908292 (1) CHEMBL2049767 (1) CHEMBL2077111 (1) CHEMBL2076084 (1) CHEMBL2076085 (1) CHEMBL2076687 (1) CHEMBL2076716 (1) CHEMBL2077350 (1) CHEMBL2075168 (1) CHEMBL2076146 (1) CHEMBL2075700 (1) CHEMBL2075701 (1) CHEMBL2076415 (1) CHEMBL2076420 (1) CHEMBL2076583 (1) CHEMBL2076595 (1) CHEMBL2076205 (1) CHEMBL2076207 (1) CHEMBL2076209 (1) CHEMBL2076213 (2) CHEMBL2076214 (2) CHEMBL2076218 (2) CHEMBL2076231 (1) CHEMBL2076250 (1) CHEMBL2076251 (1) CHEMBL2076066 (1) CHEMBL2078125 (1) CHEMBL2078150 (1) CHEMBL2078544 (1) CHEMBL2078545 (1) CHEMBL2078546 (1) CHEMBL2078547 (1) CHEMBL2078576 (1) | 1 / 0 | 
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL97 CHEMBL21578 | CHEMBL661229
                        (1)
                        CHEMBL1028883
                        (1) CHEMBL1741325 (2) CHEMBL2071963 (1) | 0 / 1 | 
| O15296 | Arachidonate 15-lipoxygenase B | Enzyme | CHEMBL97 | CHEMBL1613800
                        (2) | 0 / 0 | 
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1294 CHEMBL460606 | CHEMBL1614458
                        (2) | 0 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL387326 | CHEMBL2114780
                        (1) | 0 / 0 | 
| Q8TCC7 | Solute carrier family 22 member 8 | Antiporter | CHEMBL21578 | CHEMBL2076658
                        (1) | 0 / 0 | 
| P46721 | Solute carrier organic anion transporter family member 1A2 | Unclassified protein | CHEMBL21578 | CHEMBL2077102
                        (1)
                        CHEMBL2076550
                        (1) | 0 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1294 | CHEMBL2114788
                        (1) | 0 / 0 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL522505 | CHEMBL1738610
                        (1) | 0 / 0 | 
| Q9NPD5 | Solute carrier organic anion transporter family member 1B3 | Electrochemical transporter | CHEMBL21578 CHEMBL387326 | CHEMBL2169430
                        (2) | 1 / 0 | 
| P11021 | 78 kDa glucose-regulated protein | Unclassified protein | CHEMBL97 | CHEMBL1963893
                        (1) | 0 / 0 | 
| P37231 | Peroxisome proliferator-activated receptor gamma | NR1C3 | CHEMBL1294 | CHEMBL1794510
                        (1) | 5 / 3 | 
| P06276 | Cholinesterase | Hydrolase | CHEMBL21578 | CHEMBL2166019
                        (1) | 0 / 0 | 
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL97 CHEMBL21578 | CHEMBL1741322
                        (2)
                        CHEMBL2071962
                        (1) | 0 / 0 | 
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL97 CHEMBL460606 | CHEMBL1613910
                        (2) | 3 / 3 | 
| Q92887 | Canalicular multispecific organic anion transporter 1 | Unclassified protein | CHEMBL21578 CHEMBL387326 | CHEMBL1006005
                        (2)
                        CHEMBL2075102
                        (1) | 1 / 1 | 
| Q86VL8 | Multidrug and toxin extrusion protein 2 | Cation antiporter | CHEMBL21578 | CHEMBL1743175
                        (1) | 0 / 0 | 
| Q14524 | Sodium channel protein type 5 subunit alpha | SCN alpha, NaV1.x | CHEMBL21578 | CHEMBL905110
                        (1) | 9 / 7 | 
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL97 CHEMBL21578 | CHEMBL1028884
                        (1)
                        CHEMBL1741323
                        (2) CHEMBL2071964 (1) | 1 / 1 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL97 CHEMBL21578 CHEMBL1294 CHEMBL387326 CHEMBL460606 | CHEMBL664809
                        (1)
                        CHEMBL836230
                        (1) CHEMBL1028885 (1) CHEMBL1614108 (3) CHEMBL1613886 (3) CHEMBL1741324 (2) CHEMBL1743273 (2) CHEMBL2071966 (1) CHEMBL2071967 (1) | 0 / 1 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1878119 | CHEMBL1794483
                        (1) | 0 / 0 | 
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL1294 | CHEMBL2114890
                        (1) | 0 / 0 | 
| P22460 | Potassium voltage-gated channel subfamily A member 5 | KCNA, Kv1.x (Shaker) | CHEMBL21578 | CHEMBL905111
                        (1) | 1 / 1 | 
| P04156 | Major prion protein | Surface antigen | CHEMBL21578 | CHEMBL2155230
                        (1) | 6 / 2 | 
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1364159 | CHEMBL1794536
                        (1) | 0 / 0 | 
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL460606 | CHEMBL1613914
                        (1) | 0 / 0 | 
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL522505 | CHEMBL1738442
                        (1) | 0 / 0 | 
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL1294 | CHEMBL1614364
                        (1) | 1 / 1 | 
| O00255 | Menin | Unclassified protein | CHEMBL460606 | CHEMBL1614531
                        (1) | 2 / 5 | 
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL460606 | CHEMBL1614531
                        (1) | 1 / 3 | 
| Q9H015 | Solute carrier family 22 member 4 | Unclassified protein | CHEMBL21578 CHEMBL387326 | CHEMBL2077088
                        (1)
                        CHEMBL2076152
                        (1) CHEMBL2076153 (1) | 1 / 1 | 
| O76082 | Solute carrier family 22 member 5 | Unclassified protein | CHEMBL21578 CHEMBL387326 | CHEMBL2076256
                        (1)
                        CHEMBL2078104
                        (1) CHEMBL2078105 (1) | 1 / 2 | 
| Q9NY46 | Sodium channel protein type 3 subunit alpha | SCN alpha, NaV1.x | CHEMBL21578 CHEMBL387326 | CHEMBL806152
                        (2)
                        CHEMBL806153
                        (2) | 0 / 0 | 
| Q99250 | Sodium channel protein type 2 subunit alpha | SCN alpha, NaV1.x | CHEMBL21578 CHEMBL387326 | CHEMBL806152
                        (2)
                        CHEMBL806153
                        (2) | 2 / 2 | 
| P35498 | Sodium channel protein type 1 subunit alpha | SCN alpha, NaV1.x | CHEMBL21578 CHEMBL387326 | CHEMBL806152
                        (2)
                        CHEMBL806153
                        (2) | 3 / 2 | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| D011803 | 5243 | ABCB1 ABC20 CD243 CLCS GP170 MDR1 P-GP PGY1 | ATP-binding cassette, sub-family B (MDR/TAP), member 1 (EC:3.6.3.44) | ABCB1 protein affects the uptake of Quinine analog | affects uptake | protein | 11934808 | 
| D011803 | 351 | APP AAA ABETA ABPP AD1 APPI CTFgamma CVAP PN-II PN2 | amyloid beta (A4) precursor protein | Quinine affects the reaction [APP protein binds to APP protein] | affects binding / affects reaction | protein | 18537544 | 
| D011803 | 1543 | CYP1A1 AHH AHRR CP11 CYP1 P1-450 P450-C P450DX | cytochrome P450, family 1, subfamily A, polypeptide 1 (EC:1.14.14.1) | Quinine results in increased activity of CYP1A1 protein | increases activity | protein | 12451431 | 
| D011803 | 1543 | CYP1A1 AHH AHRR CP11 CYP1 P1-450 P450-C P450DX | cytochrome P450, family 1, subfamily A, polypeptide 1 (EC:1.14.14.1) | Quinine results in increased expression of CYP1A1 mRNA | increases expression | mRNA | 12451431 | 
| D011803 | 1544 | CYP1A2 CP12 P3-450 P450(PA) | cytochrome P450, family 1, subfamily A, polypeptide 2 (EC:1.14.14.1) | Quinine results in increased expression of CYP1A2 mRNA | increases expression | mRNA | 12451431 | 
| D011803 | 1557 | CYP2C19 CPCJ CYP2C P450C2C P450IIC19 | cytochrome P450, family 2, subfamily C, polypeptide 19 (EC:1.14.13.48 1.14.13.49 1.14.13.80) | Quinine results in decreased activity of CYP2C19 protein | decreases activity | protein | 11124226 | 
| D011803 | 1559 | CYP2C9 CPC9 CYP2C CYP2C10 CYPIIC9 P450IIC9 | cytochrome P450, family 2, subfamily C, polypeptide 9 (EC:1.14.13.48 1.14.13.49 1.14.13.80) | Quinine inhibits the reaction [CYP2C9 protein affects the metabolism of Diclofenac] | affects metabolic processing / decreases reaction | protein | 16081671 | 
| D011803 | 1559 | CYP2C9 CPC9 CYP2C CYP2C10 CYPIIC9 P450IIC9 | cytochrome P450, family 2, subfamily C, polypeptide 9 (EC:1.14.13.48 1.14.13.49 1.14.13.80) | Quinine results in decreased activity of CYP2C9 protein | decreases activity | protein | 11124226 | 
| D011803 | 1576 | CYP3A4 CP33 CP34 CYP3A CYP3A3 CYPIIIA3 CYPIIIA4 HLP NF-25 P450C3 P450PCN1 | cytochrome P450, family 3, subfamily A, polypeptide 4 (EC:1.14.13.67 1.14.13.97 1.14.13.32 1.14.13.157) | CYP3A4 protein affects the metabolism of Quinine | affects metabolic processing | protein | 12920490 15896247 | 
| D011803 | 1576 | CYP3A4 CP33 CP34 CYP3A CYP3A3 CYPIIIA3 CYPIIIA4 HLP NF-25 P450C3 P450PCN1 | cytochrome P450, family 3, subfamily A, polypeptide 4 (EC:1.14.13.67 1.14.13.97 1.14.13.32 1.14.13.157) | Quinine results in decreased activity of CYP3A4 protein | decreases activity | protein | 11124226 | 
| D011803 | 2944 | GSTM1 GST1 GSTM1-1 GSTM1a-1a GSTM1b-1b GTH4 GTM1 H-B MU MU-1 | glutathione S-transferase mu 1 (EC:2.5.1.18) | Quinine results in decreased activity of GSTM1 protein | decreases activity | protein | 11807801 | 
| D011803 | 2950 | GSTP1 DFN7 FAEES3 GST3 GSTP PI | glutathione S-transferase pi 1 (EC:2.5.1.18) | Quinine inhibits the reaction [GSTP1 protein affects the metabolism of and results in decreased activity of Ethacrynic Acid] | affects metabolic processing / decreases activity / decreases reaction | protein | 11807801 | 
| D011803 | 2950 | GSTP1 DFN7 FAEES3 GST3 GSTP PI | glutathione S-transferase pi 1 (EC:2.5.1.18) | Quinine results in decreased activity of GSTP1 protein | decreases activity | protein | 11807801 | 
| D011803 | 3552 | IL1A IL-1A IL1 IL1-ALPHA IL1F1 | interleukin 1, alpha | [IL6 protein co-treated with IL1A protein co-treated with TNF protein co-treated with lipopolysaccharide, Escherichia coli 0111 B4] results in increased susceptibility to Quinine | affects cotreatment / increases response to substance | protein | 19362101 | 
| D011803 | 3569 | IL6 BSF2 HGF HSF IFNB2 IL-6 | interleukin 6 (interferon, beta 2) | [IL6 protein co-treated with IL1A protein co-treated with TNF protein co-treated with lipopolysaccharide, Escherichia coli 0111 B4] results in increased susceptibility to Quinine | affects cotreatment / increases response to substance | protein | 19362101 | 
| D011803 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | KCNH2 gene SNP affects the susceptibility to Quinine | affects response to substance | gene | 12695533 | 
| D011803 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | Quinine results in decreased activity of KCNH2 protein | decreases activity | protein | 12695533 | 
| D011803 | 338567 | KCNK18 K2p18.1 MGR13 TRESK TRESK-2 TRESK2 TRIK | potassium channel, subfamily K, member 18 | Quinine inhibits the reaction [KCNK18 protein results in increased transport of Potassium] | decreases reaction / increases transport | protein | 12754259 | 
| D011803 | 6580 | SLC22A1 HOCT1 OCT1 oct1_cds | solute carrier family 22 (organic cation transporter), member 1 | Quinine inhibits the reaction [SLC22A1 protein results in increased transport of 1-Methyl-4-phenylpyridinium] | decreases reaction / increases transport | protein | 16263091 | 
| D011803 | 6582 | SLC22A2 OCT2 | solute carrier family 22 (organic cation transporter), member 2 | Quinine inhibits the reaction [SLC22A2 protein results in increased transport of 1-Methyl-4-phenylpyridinium] | decreases reaction / increases transport | protein | 16263091 | 
| D011803 | 6581 | SLC22A3 EMT EMTH OCT3 | solute carrier family 22 (organic cation transporter), member 3 | Quinine inhibits the reaction [SLC22A3 protein results in increased transport of 1-Methyl-4-phenylpyridinium] | decreases reaction / increases transport | protein | 16263091 | 
| D011803 | 84679 | SLC9A7 NHE-7 NHE7 SLC9A6 | solute carrier family 9, subfamily A (NHE7, cation proton antiporter 7), member 7 | Quinine results in decreased activity of SLC9A7 protein | decreases activity | protein | 11279194 | 
| D011803 | 7124 | TNF DIF TNF-alpha TNFA TNFSF2 | tumor necrosis factor | [IL6 protein co-treated with IL1A protein co-treated with TNF protein co-treated with lipopolysaccharide, Escherichia coli 0111 B4] results in increased susceptibility to Quinine | affects cotreatment / increases response to substance | protein | 19362101 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #300438 | 17-beta-hydroxysteroid dehydrogenase x deficiency | Q99714 | 
| #614022 | Atrial fibrillation, familial, 10; atfb10 | Q14524 | 
| #612240 | Atrial fibrillation, familial, 7; atfb7 | P22460 | 
| #108770 | Atrial standstill | Q14524 | 
| %606641 | Body mass index; bmi | P37231 | 
| #601144 | Brugada syndrome 1; brgda1 | Q14524 | 
| #601154 | Cardiomyopathy, dilated, 1e; cmd1e | Q14524 | 
| #212140 | Carnitine deficiency, systemic primary; cdsp | O76082 | 
| #609338 | Carotid intimal medial thickness 1 | P37231 | 
| #605479 | Cholestasis, benign recurrent intrahepatic, 2; bric2 | O95342 | 
| #601847 | Cholestasis, progressive familial intrahepatic, 2; pfic2 | O95342 | 
| #123400 | Creutzfeldt-jakob disease; cjd | P04156 | 
| #127750 | Dementia, lewy body; dlb | P37840 | 
| #607208 | Dravet syndrome | P35498 | 
| #609535 | Drug metabolism, poor, cyp2c19-related | P33261 | 
| #608902 | Drug metabolism, poor, cyp2d6-related | P10635 | 
| #237500 | Dubin-johnson syndrome; djs | Q92887 | 
| #613721 | Epileptic encephalopathy, early infantile, 11; eiee11 | Q99250 | 
| #600072 | Fatal familial insomnia; ffi | P04156 | 
| #604403 | Generalized epilepsy with febrile seizures plus, type 2; gefsp2 | P35498 | 
| #137440 | Gerstmann-straussler disease; gsd | P04156 | 
| #137800 | Glioma susceptibility 1; glm1 | P37231 | 
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay | Q03164 | 
| #603218 | Huntington disease-like 1; hdl1 | P04156 | 
| #237450 | Hyperbilirubinemia, rotor type; hblrr | Q9NPD5 Q9Y6L6 | 
| #145000 | Hyperparathyroidism 1; hrpt1 | O00255 | 
| #603373 | Hyperthyroidism, familial gestational | P16473 | 
| #609152 | Hyperthyroidism, nonautoimmune | P16473 | 
| #275200 | Hypothyroidism, congenital, nongoitrous, 1; chng1 | P16473 | 
| #612244 | Inflammatory bowel disease 13; ibd13 | P08183 | 
| #245300 | Kuru, susceptibility to | P04156 | 
| #604367 | Lipodystrophy, familial partial, type 3; fpld3 | P37231 | 
| #613688 | Long qt syndrome 2; lqt2 | Q12809 | 
| #603830 | Long qt syndrome 3; lqt3 | Q14524 | 
| #300705 | Mental retardation, x-linked 17; mrx17 | Q99714 | 
| #300220 | Mental retardation, x-linked, syndromic 10; mrxs10 | Q99714 | 
| #609634 | Migraine, familial hemiplegic, 3; fhm3 | P35498 | 
| #131100 | Multiple endocrine neoplasia, type i; men1 | O00255 | 
| #601665 | Obesity | P37231 | 
| #168601 | Parkinson disease 1, autosomal dominant; park1 | P37840 | 
| #605543 | Parkinson disease 4, autosomal dominant; park4 | P37840 | 
| #168600 | Parkinson disease, late-onset; pd | P37840 | 
| #113900 | Progressive familial heart block, type ia; pfhb1a | Q14524 | 
| #180300 | Rheumatoid arthritis; ra | Q9H015 | 
| #607745 | Seizures, benign familial infantile, 3; bfis3 | Q99250 | 
| #609620 | Short qt syndrome 1; sqt1 | Q12809 | 
| #608567 | Sick sinus syndrome 1, autosomal recessive; sss1 | Q14524 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 | 
| #607250 | Spinocerebellar ataxia, autosomal recessive, with axonal neuropathy; scan1 | Q9NUW8 | 
| #606688 | Spongiform encephalopathy with neuropsychiatric features | P04156 | 
| #272120 | Sudden infant death syndrome | Q14524 | 
| #188570 | Thyroid hormone resistance, generalized, autosomal dominant; grth | P10828 | 
| #274300 | Thyroid hormone resistance, generalized, autosomal recessive; grth | P10828 | 
| #145650 | Thyroid hormone resistance, selective pituitary; prth | P10828 | 
| #603829 | Ventricular fibrillation during myocardial infarction, susceptibility to | Q14524 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00033 | Adrenal carcinoma | O00255
                            (related) | 
| H00034 | Carcinoid | O00255
                            (related) | 
| H00045 | Malignant islet cell carcinoma | O00255
                            (related) | 
| H00246 | Primary hyperparathyroidism | O00255
                            (related) | 
| H01102 | Pituitary adenomas | O00255
                            (related) | 
| H00286 | Crohn's disease | O76082
                            (related) Q9H015 (related) | 
| H00525 | Disorders of fatty-acid oxidation | O76082
                            (related) | 
| H00624 | Familial cholestasis | O95342
                            (related) | 
| H00061 | Prion diseases | P04156
                            (related) | 
| H01243 | Huntington's disease-like syndrome | P04156
                            (related) | 
| H00036 | Osteosarcoma | P08684
                            (marker) | 
| H00249 | Thyroid hormone resistance syndrome | P10828
                            (related) | 
| H01205 | Coumarin resistance | P11712
                            (related) | 
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) | P16473
                            (related) | 
| H01269 | Congenital hyperthyroidism | P16473
                            (related) | 
| H00731 | Atrial fibrillation | P22460
                            (related) Q14524 (related) | 
| H01171 | Poor drug metabolism (PM) | P33261
                            (related) | 
| H00775 | Familial or sporadic hemiplegic migraine | P35498
                            (related) | 
| H00783 | Febrile seizures | P35498
                            (related) | 
| H00032 | Thyroid cancer | P37231
                            (related) | 
| H00409 | Type II diabetes mellitus | P37231
                            (related) | 
| H00420 | Familial partial lipodystrophy (FPL) | P37231
                            (related) | 
| H00057 | Parkinson's disease (PD) | P37840
                            (related) | 
| H00066 | Lewy body dementia (LBD) | P37840
                            (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q03164
                            (related) Q03164 (marker) | 
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) | Q03164
                            (related) | 
| H00720 | Long QT syndrome | Q12809
                            (related) Q14524 (related) | 
| H00725 | Short QT syndrome | Q12809
                            (related) | 
| H00294 | Dilated cardiomyopathy (DCM) | Q14524
                            (related) | 
| H00728 | Brugada syndrome (BRS) | Q14524
                            (related) | 
| H00729 | Sick sinus syndrome (SSS) | Q14524
                            (related) | 
| H00730 | Familial idiopathic ventricular fibrillation | Q14524
                            (related) | 
| H01263 | Progressive cardiac conduction defect (PCCD) | Q14524
                            (related) | 
| H00208 | Hyperbilirubinemia | Q92887
                            (related) | 
| H00606 | Early infantile epileptic encephalopathy | Q99250
                            (related) | 
| H00806 | Benign familial neonatal and infantile epilepsies | Q99250
                            (related) | 
| H00063 | Spinocerebellar ataxia (SCA) | Q99700
                            (related) Q9NUW8 (related) | 
| H00480 | Non-syndromic X-linked mental retardation | Q99714
                            (related) | 
| H00658 | Syndromic X-linked mental retardation | Q99714
                            (related) | 
| H00925 | 2-Methyl-3-hydroxybutyryl-CoA dehydrogenase (MHBD) deficiency | Q99714
                            (related) | 
| MeSH disease | OMIM | compound | disease name | evidence type | reference pmid | 
|---|---|---|---|---|---|
| D015746 | D011803 | Abdominal Pain | marker/mechanism | 3800084 | |
| D000014 | D011803 | Abnormalities, Drug-Induced | marker/mechanism | 5973659 | |
| D058186 | D011803 | Acute Kidney Injury | marker/mechanism | 12682720 16780456 | |
| D000380 | D011803 | Agranulocytosis | marker/mechanism | 1611088 | |
| D000550 | D011803 | Amblyopia | marker/mechanism | 4671314 5539279 5700677 7369302 | |
| D000743 | D011803 | Anemia, Hemolytic | marker/mechanism | 17381629 18343736 | |
| D000855 | D011803 | Anorexia | marker/mechanism | 6582023 | |
| D001008 | D011803 | Anxiety Disorders | marker/mechanism | 1506013 | |
| D001145 | D011803 | Arrhythmias, Cardiac | marker/mechanism | 3983356 9604078 11837778 | |
| D054537 | D011803 | Atrioventricular Block | marker/mechanism | 3800084 | |
| D001766 | D011803 | Blindness | marker/mechanism | 1341094 2024217 3800084 3885879 3926054 4671314 5700677 6054919 6530841 7369302 8758098 9517707 10341779 11848734 14676522 15373380 | |
| D001919 | D011803 | Bradycardia | marker/mechanism | 3800084 8957602 | |
| D001943 | D011803 | Breast Neoplasms | therapeutic | 9116320 | |
| D002637 | D011803 | Chest Pain | marker/mechanism | 9517707 | |
| D016770 | D011803 | Ciliophora Infections | therapeutic | 12113305 | |
| D003128 | D011803 | COMA | marker/mechanism therapeutic | 14765563 15107507 | |
| D003221 | D011803 | Confusion | marker/mechanism | 3800084 14676522 14765563 | |
| D003638 | D011803 | Deafness | marker/mechanism | 5700677 | |
| D003872 | D011803 | Dermatitis | marker/mechanism | 4229630 | |
| D004195 | D011803 | Disease Models, Animal | marker/mechanism | 1910705 | |
| D004211 | D011803 | Disseminated Intravascular Coagulation | marker/mechanism | 1979368 2393740 8323089 10474732 12013332 12682720 16780456 18343736 | |
| D004244 | D011803 | Dizziness | marker/mechanism | 1796238 9116320 | |
| D003875 | D011803 | Drug Eruptions | marker/mechanism | 1998811 | |
| D056486 | D011803 | Drug-Induced Liver Injury | marker/mechanism | 15047046 19362101 22166485 23152190 | |
| D062787 | D011803 | Drug Overdose | marker/mechanism | 9517707 | |
| D004417 | D011803 | Dyspnea | marker/mechanism | 9517707 | |
| D004421 | D011803 | Dystonia | marker/mechanism | 14697088 | |
| D004830 | D011803 | Epilepsy, Tonic-Clonic | marker/mechanism | 8138671 | |
| D005315 | D011803 | Fetal Diseases | marker/mechanism | 5973659 | |
| D005334 | D011803 | Fever | therapeutic | 8138671 15107507 | |
| D005393 | D011803 | Fish Diseases | therapeutic | 12113305 | |
| D006099 | D011803 | Granuloma | marker/mechanism | 6402064 8628066 15047046 | |
| D006261 | D011803 | Headache | marker/mechanism | 3800084 | |
| D006311 | D011803 | Hearing Disorders | marker/mechanism | 1842280 8046138 | |
| D034381 | D011803 | Hearing Loss | marker/mechanism | 2049249 2198912 2406680 3800084 7855666 8143397 8471402 9039480 9134134 9517707 20502380 | |
| D006319 | D011803 | Hearing Loss, Sensorineural | marker/mechanism | 3872601 9657511 18796142 | |
| D006331 | D011803 | Heart Diseases | marker/mechanism | 3926054 22166485 | |
| D006461 | D011803 | Hemolysis | marker/mechanism | 4229630 5338485 6928056 7316411 | |
| D006463 | D011803 | Hemolytic-Uremic Syndrome | marker/mechanism | 1415380 1611088 1898704 7679450 7977300 8160939 9202872 10923967 11604563 11747383 12013332 12432194 12682720 12759685 14671503 16388419 16780456 20799358 | |
| D006470 | D011803 | Hemorrhage | marker/mechanism | 1998811 | |
| D006505 | D011803 | Hepatitis | marker/mechanism | 2108777 6402064 8628066 | |
| D006948 | D011803 | Hyperkinesis | therapeutic | 10390729 | |
| D007008 | D011803 | Hypokalemia | marker/mechanism | 9517707 | |
| D007022 | D011803 | Hypotension | marker/mechanism | 9561594 | |
| D007024 | D011803 | Hypotension, Orthostatic | marker/mechanism | 8513843 9518913 | |
| D007673 | D011803 | Kidney Cortex Necrosis | marker/mechanism | 18343736 | |
| D008133 | D011803 | Long QT Syndrome | marker/mechanism | 9517707 16178046 | |
| D008269 | D011803 | Macular Edema | marker/mechanism | 1341094 4671314 6054919 | |
| D008288 | D011803 | Malaria | therapeutic | 1796238 1896775 2406680 8116811 8619448 8957602 15107507 18717145 18807436 | |
| D016779 | D011803 | Malaria, Cerebral | therapeutic | 8644976 | |
| D016778 | D011803 | Malaria, Falciparum | therapeutic | 1101464 4885738 6340187 8202114 8513843 9561594 9604078 15215119 17297207 | |
| D009120 | D011803 | Muscle Cramp | therapeutic | 1457303 1457907 1979368 12074203 14744847 18343736 19260037 | |
| D009224 | D011803 | Myotonia Congenita | marker/mechanism | 1896199 | |
| D009336 | D011803 | Necrosis | marker/mechanism | 12432194 | |
| D009395 | D011803 | Nephritis, Interstitial | marker/mechanism | 8048427 | |
| D009468 | D011803 | Neuromuscular Diseases | marker/mechanism | 16568672 | |
| D009503 | D011803 | Neutropenia | marker/mechanism | 1421383 | |
| D009896 | D011803 | Optic Atrophy | marker/mechanism | 5539279 | |
| D009901 | D011803 | Optic Nerve Diseases | marker/mechanism | 5977436 | |
| D010146 | D011803 | Pain | therapeutic | 7352543 | |
| D010198 | D011803 | Pancytopenia | marker/mechanism | 8323089 | |
| D018512 | D011803 | Parasitemia | therapeutic | 1896775 8138671 15107507 | |
| D010787 | D011803 | Photosensitivity Disorders | marker/mechanism | 1998811 | |
| D011041 | D011803 | Poisoning | marker/mechanism | 3800084 3926054 3983356 14676522 | |
| D011618 | D011803 | Psychotic Disorders | marker/mechanism | 5338485 | |
| D011697 | D011803 | Purpura, Thrombotic Thrombocytopenic | marker/mechanism | 8323089 11604563 11747383 12432194 14671503 16388419 20799358 | |
| D051437 | D011803 | Renal Insufficiency | marker/mechanism | 1421383 1898704 2393740 5426771 8048427 8323089 19260037 22166485 | |
| D012164 | D011803 | Retinal Diseases | marker/mechanism | 8543087 | |
| D012206 | D011803 | Rhabdomyolysis | marker/mechanism | 16780456 | |
| D012640 | D011803 | Seizures | marker/mechanism | 1322322 14765563 | |
| D020922 | D011803 | Sleep-Wake Transition Disorders | therapeutic | 10474732 | |
| D013575 | D011803 | Syncope | marker/mechanism | 9604078 | |
| D013610 | D011803 | Tachycardia | marker/mechanism | 3800084 9561594 | |
| D013921 | D011803 | Thrombocytopenia | marker/mechanism | 1421383 1898704 8628066 10474732 12682720 14744847 | |
| D057049 | D011803 | Thrombotic Microangiopathies | marker/mechanism | 19260037 | |
| D014012 | D011803 | Tinnitus | marker/mechanism | 1796238 1896775 1910705 2198912 3800084 9116320 9517707 17114137 20502380 | |
| D015845 | D011803 | Tonic Pupil | marker/mechanism | 7369302 | |
| D016171 | D011803 | Torsades de Pointes | marker/mechanism | 9272545 16178046 | |
| D014657 | D011803 | Vasculitis | marker/mechanism | 1457303 1998811 2108777 4238534 | |
| D014693 | D011803 | Ventricular Fibrillation | marker/mechanism | 18717145 18807436 | |
| D018879 | D011803 | Ventricular Premature Complexes | marker/mechanism | 17297207 | |
| D014786 | D011803 | Vision Disorders | marker/mechanism | 3983356 6482803 7198212 17967270 | |
| D014839 | D011803 | Vomiting | marker/mechanism | 1796238 3800084 9517707 |