id | C00002202 |
---|---|
Name | Vasicinone |
CAS RN | 486-64-6 |
Standard InChI | InChI=1S/C11H10N2O2/c14-9-5-6-13-10(9)12-8-4-2-1-3-7(8)11(13)15/h1-4,9,14H,5-6H2/t9-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C11H10N2O2/c14-9-5-6-13-10(9)12-8-4-2-1-3-7(8)11(13)15/h1-4,9,14H,5-6H2 |
Phytochemical cluster | No. 7 |
---|---|
KCF-S cluster | No. 3142 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL1864065 |
By LinkDB | C10744 |
---|
By CAS RN | C052548 |
---|
family name | count |
---|---|
Nitrariaceae | 3 |
Malvaceae | 1 |
Biebersteiniaceae | 1 |
Acanthaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1864065 |
CHEMBL1794483
(1)
|
0 / 0 |