| id | C00002202 |
|---|---|
| Name | Vasicinone |
| CAS RN | 486-64-6 |
| Standard InChI | InChI=1S/C11H10N2O2/c14-9-5-6-13-10(9)12-8-4-2-1-3-7(8)11(13)15/h1-4,9,14H,5-6H2/t9-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C11H10N2O2/c14-9-5-6-13-10(9)12-8-4-2-1-3-7(8)11(13)15/h1-4,9,14H,5-6H2 |
| Phytochemical cluster | No. 7 |
|---|---|
| KCF-S cluster | No. 3142 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1864065 |
| By LinkDB | C10744 |
|---|
| By CAS RN | C052548 |
|---|
| family name | count |
|---|---|
| Nitrariaceae | 3 |
| Malvaceae | 1 |
| Biebersteiniaceae | 1 |
| Acanthaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1864065 |
CHEMBL1794483
(1)
|
0 / 0 |