| id | C00002371 |
|---|---|
| Name | Abyssinone VI |
| CAS RN | 77263-12-8 |
| Standard InChI | InChI=1S/C25H28O4/c1-16(2)5-8-19-13-18(14-20(25(19)29)9-6-17(3)4)7-12-23(27)22-11-10-21(26)15-24(22)28/h5-7,10-15,26,28-29H,8-9H2,1-4H3/b12-7+ |
| Standard InChI (Main Layer) | InChI=1S/C25H28O4/c1-16(2)5-8-19-13-18(14-20(25(19)29)9-6-17(3)4)7-12-23(27)22-11-10-21(26)15-24(22)28/h5-7,10-15,26,28-29H,8-9H2,1-4H3 |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 190 |
| By standard InChI | CHEMBL508727 |
|---|---|
| By standard InChI Main Layer | CHEMBL508727 |
| By LinkDB | C08573 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Erythrina abyssinica | 1237573 | Fabaceae | rosids | Viridiplantae |
| Erythrina sigmoidea | 3841 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL508727 |
CHEMBL904966
(1)
|
0 / 0 |