id | C00024249 |
---|---|
Name | Citrusinine I |
CAS RN | 86680-32-2 |
Standard InChI | InChI=1S/C16H15NO5/c1-17-13-8(5-4-6-9(13)18)15(20)12-10(19)7-11(21-2)16(22-3)14(12)17/h4-7,18-19H,1-3H3 |
Standard InChI (Main Layer) | InChI=1S/C16H15NO5/c1-17-13-8(5-4-6-9(13)18)15(20)12-10(19)7-11(21-2)16(22-3)14(12)17/h4-7,18-19H,1-3H3 |
Phytochemical cluster | No. 7 |
---|---|
KCF-S cluster | No. 257 |
By standard InChI | CHEMBL451705 |
---|---|
By standard InChI Main Layer | CHEMBL451705 |
By LinkDB |
---|
By CAS RN | C062044 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Atalantia monophylla | 159025 | Rutaceae | rosids | Viridiplantae |
Severinia buxifolia | 76974 | Rutaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O60911 | Cathepsin L2 | C1A | CHEMBL451705 |
CHEMBL1670879
(1)
CHEMBL1670880
(1)
|
0 / 0 |