id | C00025235 |
---|---|
Name | Crebanin / (-)-Crebanine |
CAS RN | 25127-29-1 |
Standard InChI | InChI=1S/C20H21NO4/c1-21-7-6-11-8-16-20(25-10-24-16)18-12-4-5-15(22-2)19(23-3)13(12)9-14(21)17(11)18/h4-5,8,14H,6-7,9-10H2,1-3H3/t14-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C20H21NO4/c1-21-7-6-11-8-16-20(25-10-24-16)18-12-4-5-15(22-2)19(23-3)13(12)9-14(21)17(11)18/h4-5,8,14H,6-7,9-10H2,1-3H3 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 20 |
By standard InChI | CHEMBL1989287 |
---|---|
By standard InChI Main Layer | CHEMBL604339 CHEMBL1989287 |
By LinkDB |
---|
By CAS RN | C061009 |
---|
class name | count |
---|---|
eudicotyledons | 8 |
family name | count |
---|---|
Menispermaceae | 8 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P24941 | Cyclin-dependent kinase 2 | Cdc2 | CHEMBL604339 |
CHEMBL1067148
(1)
|
0 / 0 |