| id | C00002540 |
|---|---|
| Name | Irisolidone / 4'-O-Methyltectorigenin / 5,7-Dihydroxy-6,4'-dimethoxyisoflavone |
| CAS RN | 2345-17-7 |
| Standard InChI | InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)11-8-23-13-7-12(18)17(22-2)16(20)14(13)15(11)19/h3-8,18,20H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)11-8-23-13-7-12(18)17(22-2)16(20)14(13)15(11)19/h3-8,18,20H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL265945 |
|---|---|
| By standard InChI Main Layer | CHEMBL265945 |
| By LinkDB | C10471 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 6 |
| Liliopsida | 5 |
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Fabaceae | 6 |
| Iridaceae | 5 |
| Araucariaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P05412 | Transcription factor AP-1 | Transcription Factor | CHEMBL265945 |
CHEMBL938458
(1)
|
0 / 0 |