| id | C00025402 |
|---|---|
| Name | Norargemonine / (-)-Norargemonine / O2-Demetylargemonie / O8-Demethylargemonine |
| CAS RN | 5876-16-4 |
| Standard InChI | InChI=1S/C20H23NO4/c1-21-15-6-12-8-19(24-3)20(25-4)10-14(12)16(21)5-11-7-18(23-2)17(22)9-13(11)15/h7-10,15-16,22H,5-6H2,1-4H3/t15-,16?/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H23NO4/c1-21-15-6-12-8-19(24-3)20(25-4)10-14(12)16(21)5-11-7-18(23-2)17(22)9-13(11)15/h7-10,15-16,22H,5-6H2,1-4H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 37 |
| By standard InChI | CHEMBL1570385 |
|---|---|
| By standard InChI Main Layer | CHEMBL1570385 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 10 |
| Magnoliophyta | 3 |
| family name | count |
|---|---|
| Papaveraceae | 7 |
| Lauraceae | 2 |
| Berberidaceae | 1 |
| Ranunculaceae | 1 |
| Menispermaceae | 1 |
| Annonaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1570385 |
CHEMBL1794584
(1)
|
2 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL1570385 |
CHEMBL2114780
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #114500 | Colorectal cancer; crc |
P84022
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|