id | C00002558 |
---|---|
Name | Phaseollidin |
CAS RN | 37831-70-2 |
Standard InChI | InChI=1S/C20H20O4/c1-11(2)3-5-14-17(22)8-7-13-16-10-23-18-9-12(21)4-6-15(18)20(16)24-19(13)14/h3-4,6-9,16,20-22H,5,10H2,1-2H3/t16-,20-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C20H20O4/c1-11(2)3-5-14-17(22)8-7-13-16-10-23-18-9-12(21)4-6-15(18)20(16)24-19(13)14/h3-4,6-9,16,20-22H,5,10H2,1-2H3 |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 188 |
By standard InChI | CHEMBL508534 |
---|---|
By standard InChI Main Layer | CHEMBL508534 |
By LinkDB | C05230 |
---|
By CAS RN | C085158 |
---|
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL508534 |
CHEMBL1101504
(1)
|
0 / 0 |