| id | C00025662 | 
|---|---|
| Name | (+)-Limacine / (+)-Fangchinoline | 
| CAS RN | 436-77-1 | 
| Standard InChI | InChI=1S/C37H40N2O6/c1-38-14-12-24-19-31(42-4)33-21-27(24)28(38)16-22-6-9-26(10-7-22)44-32-18-23(8-11-30(32)41-3)17-29-35-25(13-15-39(29)2)20-34(43-5)36(40)37(35)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3/t28-,29-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C37H40N2O6/c1-38-14-12-24-19-31(42-4)33-21-27(24)28(38)16-22-6-9-26(10-7-22)44-32-18-23(8-11-30(32)41-3)17-29-35-25(13-15-39(29)2)20-34(43-5)36(40)37(35)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3 | 
| Phytochemical cluster | No. 4 | 
|---|---|
| KCF-S cluster | No. 10 | 
| By standard InChI | CHEMBL504256 | 
|---|---|
| By standard InChI Main Layer | CHEMBL504256 CHEMBL509803 CHEMBL500614 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| eudicotyledons | 3 | 
| family name | count | 
|---|---|
| Menispermaceae | 3 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Pachygone dasycarpa Kurz | 152360 | Menispermaceae | eudicotyledons | Viridiplantae | 
| Stephania hernandifolia (Willd.)Walp. | 152366 | Menispermaceae | eudicotyledons | Viridiplantae | 
| Stephania tetrandra S.Moore | 425106 | Menispermaceae | eudicotyledons | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL504256 | CHEMBL2114784
                        (1) | 1 / 1 | 
| P10253 | Lysosomal alpha-glucosidase | Hydrolase | CHEMBL504256 | CHEMBL1614076
                        (1) | 1 / 1 | 
| P07550 | Beta-2 adrenergic receptor | Adrenergic receptor | CHEMBL504256 | CHEMBL1738166
                        (1)
                        CHEMBL1794335
                        (1) | 0 / 1 | 
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL504256 | CHEMBL2077437
                        (1) | 1 / 0 | 
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL504256 | CHEMBL1008496
                        (1) | 0 / 0 | 
| P39748 | Flap endonuclease 1 | Enzyme | CHEMBL504256 | CHEMBL1794486
                        (1) | 0 / 0 | 
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL504256 | CHEMBL1794584
                        (1) | 2 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL504256 | CHEMBL2114843
                        (1)
                        CHEMBL2114780
                        (1) | 0 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL504256 | CHEMBL2114788
                        (1) | 0 / 0 | 
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL504256 | CHEMBL1737991
                        (1) | 0 / 0 | 
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL504256 | CHEMBL2354311
                        (1) | 1 / 0 | 
| Q8IUX4 | DNA dC->dU-editing enzyme APOBEC-3F | Enzyme | CHEMBL504256 | CHEMBL1963966
                        (1) | 0 / 0 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #114500 | Colorectal cancer; crc | P84022 | 
| #137800 | Glioma susceptibility 1; glm1 | O75874 | 
| #232300 | Glycogen storage disease ii | P10253 | 
| #612244 | Inflammatory bowel disease 13; ibd13 | P08183 | 
| #613795 | Loeys-dietz syndrome, type 3; lds3 | P84022 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 |