| id | C00002633 |
|---|---|
| Name | (+)-Veraguensin |
| CAS RN | 19950-55-1 |
| Standard InChI | InChI=1S/C22H28O5/c1-13-14(2)22(16-8-10-18(24-4)20(12-16)26-6)27-21(13)15-7-9-17(23-3)19(11-15)25-5/h7-14,21-22H,1-6H3/t13-,14-,21-,22+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H28O5/c1-13-14(2)22(16-8-10-18(24-4)20(12-16)26-6)27-21(13)15-7-9-17(23-3)19(11-15)25-5/h7-14,21-22H,1-6H3 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 38 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL56800 CHEMBL57542 CHEMBL418309 CHEMBL291515 CHEMBL56856 CHEMBL56917 CHEMBL112481 CHEMBL469500 |
| By LinkDB | C10892 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 14 |
| family name | count |
|---|---|
| Magnoliaceae | 3 |
| Lauraceae | 3 |
| Piperaceae | 3 |
| Schisandraceae | 2 |
| Saururaceae | 1 |
| Trimeniaceae | 1 |
| Myristicaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P25105 | Platelet-activating factor receptor | PAF receptor | CHEMBL112481 |
CHEMBL882497
(1)
|
0 / 0 |