| id | C00002704 |
|---|---|
| Name | Paeonol |
| CAS RN | 552-41-0 |
| Standard InChI | InChI=1S/C9H10O3/c1-6(10)8-4-3-7(12-2)5-9(8)11/h3-5,11H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C9H10O3/c1-6(10)8-4-3-7(12-2)5-9(8)11/h3-5,11H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1494 |
| By standard InChI | CHEMBL1079227 |
|---|---|
| By standard InChI Main Layer | CHEMBL1079227 |
| By LinkDB | C10712 |
|---|
| By CAS RN | C013638 |
|---|
| class name | count |
|---|---|
| asterids | 4 |
| rosids | 3 |
| eudicotyledons | 2 |
| Liliopsida | 2 |
| family name | count |
|---|---|
| Paeoniaceae | 2 |
| Xanthorrhoeaceae | 2 |
| Primulaceae | 2 |
| Rubiaceae | 1 |
| Moraceae | 1 |
| Apocynaceae | 1 |
| Betulaceae | 1 |
| Brassicaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1079227 |
CHEMBL1614458
(1)
|
0 / 0 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL1079227 |
CHEMBL1614521
(1)
|
0 / 0 |
| P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD(+)] | Enzyme | CHEMBL1079227 |
CHEMBL1614038
(1)
|
2 / 2 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1079227 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |