id | C00029148 |
---|---|
Name | Trispheridine / Trisphaeridine |
CAS RN | 224-11-3 |
Standard InChI | InChI=1S/C14H9NO2/c1-2-4-12-10(3-1)11-6-14-13(16-8-17-14)5-9(11)7-15-12/h1-7H,8H2 |
Standard InChI (Main Layer) | InChI=1S/C14H9NO2/c1-2-4-12-10(3-1)11-6-14-13(16-8-17-14)5-9(11)7-15-12/h1-7H,8H2 |
Phytochemical cluster | No. 7 |
---|---|
KCF-S cluster | No. 2882 |
By standard InChI | CHEMBL511443 |
---|---|
By standard InChI Main Layer | CHEMBL511443 |
By LinkDB | C12182 |
---|
By CAS RN | C462033 |
---|
class name | count |
---|---|
Liliopsida | 6 |
family name | count |
---|---|
Amaryllidaceae | 6 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL511443 |
CHEMBL2328855
(1)
|
0 / 0 |