| id | C00029502 |
|---|---|
| Name | 3-Hydroxy-4-methoxybenzoic acid |
| CAS RN | 645-08-9 |
| Standard InChI | InChI=1S/C8H8O4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3,(H,10,11) |
| Standard InChI (Main Layer) | InChI=1S/C8H8O4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3,(H,10,11) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1073 |
| By standard InChI | CHEMBL88700 |
|---|---|
| By standard InChI Main Layer | CHEMBL88700 |
| By LinkDB |
|---|
| By CAS RN | C045317 |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| asterids | 1 |
| family name | count |
|---|---|
| Iridaceae | 1 |
| Araliaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Crocus sativus | 82528 | Iridaceae | Liliopsida | Viridiplantae |
| Panax notoginseng | 44586 | Araliaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL88700 |
CHEMBL1014033
(1)
|
0 / 3 |
| P51580 | Thiopurine S-methyltransferase | Enzyme | CHEMBL88700 |
CHEMBL814140
(1)
|
1 / 1 |