id | C00029516 |
---|---|
Name | Gastrodin / (-)-Gastrodin / 4-(beta-D-Glucopyranosyloxy) benzyl alcohol |
CAS RN | 62499-27-8 |
Standard InChI | InChI=1S/C13H18O7/c14-5-7-1-3-8(4-2-7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2/t9-,10-,11+,12-,13-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C13H18O7/c14-5-7-1-3-8(4-2-7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2 |
Phytochemical cluster | No. 72 |
---|---|
KCF-S cluster | No. 45 |
By standard InChI | CHEMBL274739 |
---|---|
By standard InChI Main Layer | CHEMBL274739 |
By LinkDB | C16964 |
---|
By CAS RN | C045345 |
---|
class name | count |
---|---|
Liliopsida | 3 |
rosids | 1 |
family name | count |
---|---|
Orchidaceae | 3 |
Cucurbitaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Anoectochilus formosanus | 173437 | Orchidaceae | Liliopsida | Viridiplantae |
Citrullus colocynthis (L.) | 3653 | Cucurbitaceae | rosids | Viridiplantae |
Gastrodia elata | 91201 | Orchidaceae | Liliopsida | Viridiplantae |
Gymnadenia conopsea | 59324 | Orchidaceae | Liliopsida | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P51649 | Succinate-semialdehyde dehydrogenase, mitochondrial | Oxidoreductase | CHEMBL274739 |
CHEMBL867028
(1)
|
1 / 1 |
P80404 | 4-aminobutyrate aminotransferase, mitochondrial | Transferase | CHEMBL274739 |
CHEMBL867027
(1)
|
1 / 1 |