| id | C00003102 |
|---|---|
| Name | Cornin / Verbenalin |
| CAS RN | 548-37-8 |
| Standard InChI | InChI=1S/C17H24O10/c1-6-3-8(19)11-7(15(23)24-2)5-25-16(10(6)11)27-17-14(22)13(21)12(20)9(4-18)26-17/h5-6,9-14,16-18,20-22H,3-4H2,1-2H3/t6-,9?,10+,11-,12+,13-,14?,16-,17-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H24O10/c1-6-3-8(19)11-7(15(23)24-2)5-25-16(10(6)11)27-17-14(22)13(21)12(20)9(4-18)26-17/h5-6,9-14,16-18,20-22H,3-4H2,1-2H3 |
| Phytochemical cluster | No. 36 |
|---|---|
| KCF-S cluster | No. 56 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1080178 CHEMBL1375107 |
| By LinkDB | C09802 |
|---|
| By CAS RN | C000511 |
|---|
| class name | count |
|---|---|
| asterids | 10 |
| family name | count |
|---|---|
| Plantaginaceae | 3 |
| Cornaceae | 3 |
| Verbenaceae | 3 |
| Symplocaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1080178 |
CHEMBL1794584
(1)
|
2 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1080178 |
CHEMBL1738588
(1)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL1375107 |
CHEMBL1614421
(1)
|
4 / 3 |
| O00255 | Menin | Unclassified protein | CHEMBL1375107 |
CHEMBL1614257
(1)
CHEMBL1614531
(1)
|
2 / 5 |
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL1375107 |
CHEMBL1614257
(1)
CHEMBL1614531
(1)
|
1 / 3 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #114500 | Colorectal cancer; crc |
P84022
|
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #172700 | Pick disease of brain |
P10636
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
|
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
|
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q03164
(related)
Q03164 (marker) |
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|