| id | C00031089 |
|---|---|
| Name | Protocatechuic acid methyl ester |
| CAS RN | 2150-43-8 |
| Standard InChI | InChI=1S/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C8H8O4/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,9-10H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1722 |
| By standard InChI | CHEMBL486027 |
|---|---|
| By standard InChI Main Layer | CHEMBL486027 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Begoniaceae | 1 |
| Iridaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Begonia nantoensis | 78253 | Begoniaceae | rosids | Viridiplantae |
| Crocus sativus | 82528 | Iridaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P43166 | Carbonic anhydrase 7 | Lyase | CHEMBL486027 |
CHEMBL2340802
(1)
|
0 / 0 |
| P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL486027 |
CHEMBL1014040
(1)
|
1 / 1 |
| P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL486027 |
CHEMBL2340803
(1)
|
1 / 2 |
| Q9ULX7 | Carbonic anhydrase 14 | Lyase | CHEMBL486027 |
CHEMBL2340799
(1)
|
0 / 0 |
| O43570 | Carbonic anhydrase 12 | Lyase | CHEMBL486027 |
CHEMBL2340800
(1)
|
1 / 2 |
| P00915 | Carbonic anhydrase 1 | Lyase | CHEMBL486027 |
CHEMBL2340804
(1)
|
0 / 0 |
| Q16790 | Carbonic anhydrase 9 | Lyase | CHEMBL486027 |
CHEMBL2340801
(1)
|
0 / 1 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #143860 | Hyperchlorhidrosis, isolated |
O43570
|
| #259730 | Osteopetrosis, autosomal recessive 3; optb3 |
P00918
|
| #278300 | Xanthinuria, type i |
P47989
|
| KEGG | disease name | UniProt |
|---|---|---|
| H01302 | Hyperchlorhidrosis isolated (HCHLH) |
O43570
(related)
|
| H00021 | Renal cell carcinoma |
O43570
(marker)
Q16790 (marker) |
| H00241 | Combined proximal and distal renal tubular acidosis (RTA type 3) |
P00918
(related)
|
| H00436 | Osteopetrosis |
P00918
(related)
|
| H00192 | Xanthinuria |
P47989
(related)
|