| id | C00032017 |
|---|---|
| Name | Methylpseudoephedrine / (1S,2S)-N-Methylpseudoephedrine |
| CAS RN | 51018-28-1 |
| Standard InChI | InChI=1S/C11H17NO/c1-9(12(2)3)11(13)10-7-5-4-6-8-10/h4-9,11,13H,1-3H3/t9-,11+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C11H17NO/c1-9(12(2)3)11(13)10-7-5-4-6-8-10/h4-9,11,13H,1-3H3 |
| Phytochemical cluster | No. 9 |
|---|---|
| KCF-S cluster | No. 2149 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL445001 CHEMBL1589978 |
| By LinkDB | C17903 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 2 |
| family name | count |
|---|---|
| Ephedraceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Ephedra intermedia | 173278 | Ephedraceae | Spermatophyta | Viridiplantae |
| Ephedra sinca | 3387 | Ephedraceae | Spermatophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1589978 |
CHEMBL1614458
(1)
|
0 / 0 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL1589978 |
CHEMBL1613914
(1)
|
0 / 0 |
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL1589978 |
CHEMBL1738442
(1)
|
0 / 0 |