| id | C00032518 |
|---|---|
| Name | Xanthopurpurin |
| CAS RN | 518-83-2 |
| Standard InChI | InChI=1S/C14H8O4/c15-7-5-10-12(11(16)6-7)14(18)9-4-2-1-3-8(9)13(10)17/h1-6,15-16H |
| Standard InChI (Main Layer) | InChI=1S/C14H8O4/c15-7-5-10-12(11(16)6-7)14(18)9-4-2-1-3-8(9)13(10)17/h1-6,15-16H |
| Phytochemical cluster | No. 62 |
|---|---|
| KCF-S cluster | No. 41 |
| By standard InChI | CHEMBL372711 |
|---|---|
| By standard InChI Main Layer | CHEMBL372711 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Rubia wallichiana DECNE | 25473 | Rubiaceae | asterids | Viridiplantae |
| Rubia yunnanensis | 25473 | Rubiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | Other cytosolic protein | CHEMBL372711 |
CHEMBL2188686
(1)
|
0 / 0 |
| P10415 | Apoptosis regulator Bcl-2 | Other cytosolic protein | CHEMBL372711 |
CHEMBL2188685
(1)
|
0 / 7 |
| KEGG | disease name | UniProt |
|---|---|---|
| H00005 | Chronic lymphocytic leukemia (CLL) |
P10415
(related)
|
| H00013 | Small cell lung cancer |
P10415
(related)
|
| H00018 | Gastric cancer |
P10415
(related)
|
| H00028 | Choriocarcinoma |
P10415
(related)
|
| H00030 | Cervical cancer |
P10415
(related)
|
| H00041 | Kaposi's sarcoma |
P10415
(related)
|
| H00054 | Nasopharyngeal cancer |
P10415
(related)
|