| id | C00035014 |
|---|---|
| Name | 2-Hydroxyxanthone |
| CAS RN | 1915-98-6 |
| Standard InChI | InChI=1S/C13H8O3/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h1-7,14H |
| Standard InChI (Main Layer) | InChI=1S/C13H8O3/c14-8-5-6-12-10(7-8)13(15)9-3-1-2-4-11(9)16-12/h1-7,14H |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 76 |
| By standard InChI | CHEMBL185960 |
|---|---|
| By standard InChI Main Layer | CHEMBL185960 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 7 |
| family name | count |
|---|---|
| Calophyllaceae | 6 |
| Hypericaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL185960 |
CHEMBL827909
(1)
|
1 / 1 |