| id | C00035128 |
|---|---|
| Name | m-Cresol / m-Oxytoluene |
| CAS RN | 108-39-4 |
| Standard InChI | InChI=1S/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C7H8O/c1-6-3-2-4-7(8)5-6/h2-5,8H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1546 |
| By standard InChI | CHEMBL298312 |
|---|---|
| By standard InChI Main Layer | CHEMBL298312 |
| By LinkDB | C01467 |
|---|
| By CAS RN | C042041 |
|---|
| family name | count |
|---|---|
| Solanaceae | 2 |
| Meliaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Melia azadirach | 155640 | Meliaceae | rosids | Viridiplantae |
| Nicotiana bonariensis | 118694 | Solanaceae | asterids | Viridiplantae |
| Nicotiana cavicola | 118690 | Solanaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL298312 |
CHEMBL1794561
(1)
|
3 / 1 |
| P19793 | Retinoic acid receptor RXR-alpha | NR2B1 | CHEMBL298312 |
CHEMBL1794371
(1)
|
0 / 0 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL298312 |
CHEMBL1738606
(1)
|
0 / 0 |
| P22303 | Acetylcholinesterase | Hydrolase | CHEMBL298312 |
CHEMBL648291
(1)
CHEMBL643382
(1)
|
1 / 0 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL298312 |
CHEMBL2114890
(1)
|
0 / 0 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL298312 |
CHEMBL1794536
(1)
|
0 / 0 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C042041 | 6329 |
SCN4A
HOKPP2 HYKPP HYPP NAC1A Na(V)1.4 Nav1.4 SkM1 |
sodium channel, voltage-gated, type IV, alpha subunit | 3-cresol affects the activity of SCN4A protein polymorphism |
affects activity
|
protein |
11282107
|
| OMIM | preferred title | UniProt |
|---|---|---|
| #188570 | Thyroid hormone resistance, generalized, autosomal dominant; grth |
P10828
|
| #274300 | Thyroid hormone resistance, generalized, autosomal recessive; grth |
P10828
|
| #145650 | Thyroid hormone resistance, selective pituitary; prth |
P10828
|
| #112100 | Yt blood group antigen |
P22303
|