id | C00035823 |
---|---|
Name | Citronellal |
CAS RN | 106-23-0 |
Standard InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3 |
Standard InChI (Main Layer) | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3 |
Phytochemical cluster | No. 34 |
---|---|
KCF-S cluster | No. 1948 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL1081721 |
By LinkDB | C17384 |
---|
By CAS RN | C108217 |
---|
family name | count |
---|---|
Rutaceae | 4 |
Verbenaceae | 1 |
Lamiaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Citrus aurantifolia | 159033 | Rutaceae | rosids | Viridiplantae |
Citrus hystrix | 170989 | Rutaceae | rosids | Viridiplantae |
Citrus limon | 2708 | Rutaceae | rosids | Viridiplantae |
Citrus sinensis | 2711 | Rutaceae | rosids | Viridiplantae |
Lippia javanica | 925357 | Verbenaceae | asterids | Viridiplantae |
Melissa officinalis | 39338 | Lamiaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL1081721 |
CHEMBL1014033
(1)
|
0 / 3 |
O00519 | Fatty-acid amide hydrolase 1 | Enzyme | CHEMBL1081721 |
CHEMBL1099470
(1)
|
0 / 0 |