| id | C00035823 |
|---|---|
| Name | Citronellal |
| CAS RN | 106-23-0 |
| Standard InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3 |
| Phytochemical cluster | No. 34 |
|---|---|
| KCF-S cluster | No. 1948 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1081721 |
| By LinkDB | C17384 |
|---|
| By CAS RN | C108217 |
|---|
| family name | count |
|---|---|
| Rutaceae | 4 |
| Verbenaceae | 1 |
| Lamiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Citrus aurantifolia | 159033 | Rutaceae | rosids | Viridiplantae |
| Citrus hystrix | 170989 | Rutaceae | rosids | Viridiplantae |
| Citrus limon | 2708 | Rutaceae | rosids | Viridiplantae |
| Citrus sinensis | 2711 | Rutaceae | rosids | Viridiplantae |
| Lippia javanica | 925357 | Verbenaceae | asterids | Viridiplantae |
| Melissa officinalis | 39338 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL1081721 |
CHEMBL1014033
(1)
|
0 / 3 |
| O00519 | Fatty-acid amide hydrolase 1 | Enzyme | CHEMBL1081721 |
CHEMBL1099470
(1)
|
0 / 0 |