| id | C00036084 |
|---|---|
| Name | Cedrecoumarin A |
| CAS RN | 181637-89-8 |
| Standard InChI | InChI=1S/C14H12O4/c1-14(2)6-5-9-8-3-4-12(16)17-11(8)7-10(15)13(9)18-14/h3-7,15H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C14H12O4/c1-14(2)6-5-9-8-3-4-12(16)17-11(8)7-10(15)13(9)18-14/h3-7,15H,1-2H3 |
| Phytochemical cluster | No. 25 |
|---|---|
| KCF-S cluster | No. 750 |
| By standard InChI | CHEMBL491519 |
|---|---|
| By standard InChI Main Layer | CHEMBL491519 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cedrelopsis grevei | 864332 | Rutaceae | rosids | Viridiplantae |
| Cedrelopsis grevei Baill | 864330 | Rutaceae | rosids | Viridiplantae |
| Cedrelopsis microfoliata | 864330 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL491519 |
CHEMBL965153
(1)
|
0 / 1 |
| P03372 | Estrogen receptor | NR3A1 | CHEMBL491519 |
CHEMBL965152
(1)
|
1 / 1 |