| id | C00036782 |
|---|---|
| Name | Parmelin / Atranorin / Usnarin acid |
| CAS RN | 479-20-9 |
| Standard InChI | InChI=1S/C19H18O8/c1-8-5-12(21)11(7-20)17(23)15(8)19(25)27-13-6-9(2)14(18(24)26-4)16(22)10(13)3/h5-7,21-23H,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H18O8/c1-8-5-12(21)11(7-20)17(23)15(8)19(25)27-13-6-9(2)14(18(24)26-4)16(22)10(13)3/h5-7,21-23H,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3861 |
| By standard InChI | CHEMBL173395 |
|---|---|
| By standard InChI Main Layer | CHEMBL173395 |
| By LinkDB |
|---|
| By CAS RN | C026304 |
|---|
| class name | count |
|---|---|
| Embryophyta | 1 |
| family name | count |
|---|---|
| Parmeliaceae | 2 |
| Lejeuneaceae | 1 |
| Caliciaceae | 1 |
| Ochrolechiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Diploicia canescens | 144695 | Caliciaceae | Fungi | |
| Menegazzia asahinae | ||||
| Menegazzia terebrata | 180482 | Parmeliaceae | Fungi | |
| Ochrolechia parella | 129506 | Ochrolechiaceae | Fungi | |
| Parmelia pseudofatiscens | 87260 | Parmeliaceae | Fungi | |
| Trocholejeunea scandvicensis | 203660 | Lejeuneaceae | Embryophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL173395 |
CHEMBL1036431
(1)
|
0 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL173395 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C026304 | 581 |
BAX
BCL2L4 |
BCL2-associated X protein | atranorin results in decreased expression of BAX protein |
decreases expression
|
protein |
22285236
|
| C026304 | 596 |
BCL2
Bcl-2 PPP1R50 |
B-cell CLL/lymphoma 2 | atranorin results in decreased expression of BCL2 protein |
decreases expression
|
protein |
22285236
|
| C026304 | 598 |
BCL2L1
BCL-XL/S BCL2L BCLX BCLXL BCLXS Bcl-X PPP1R52 bcl-xL bcl-xS |
BCL2-like 1 | atranorin results in decreased expression of BCL2L1 protein |
decreases expression
|
protein |
22285236
|
| C026304 | 836 |
CASP3
CPP32 CPP32B SCA-1 |
caspase 3, apoptosis-related cysteine peptidase (EC:3.4.22.56) | atranorin results in increased activity of CASP3 protein |
increases activity
|
protein |
22285236
|
| C026304 | 7157 |
TP53
BCC7 LFS1 P53 TRP53 |
tumor protein p53 | atranorin results in decreased expression of TP53 protein |
decreases expression
|
protein |
22285236
|