id | C00037011 |
---|---|
Name | Dehydro-alpha-lapachone |
CAS RN | 15297-92-4 |
Standard InChI | InChI=1S/C15H12O3/c1-15(2)8-7-11-12(16)9-5-3-4-6-10(9)13(17)14(11)18-15/h3-8H,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C15H12O3/c1-15(2)8-7-11-12(16)9-5-3-4-6-10(9)13(17)14(11)18-15/h3-8H,1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 2274 |
By standard InChI | CHEMBL272253 |
---|---|
By standard InChI Main Layer | CHEMBL272253 |
By LinkDB |
---|
By CAS RN | C029244 |
---|
class name | count |
---|---|
asterids | 6 |
family name | count |
---|---|
Bignoniaceae | 4 |
Acanthaceae | 1 |
Lamiaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P14902 | Indoleamine 2,3-dioxygenase 1 | Enzyme | CHEMBL272253 |
CHEMBL935410
(1)
|
0 / 0 |