| id | C00038083 |
|---|---|
| Name | (+)-Neoolivil |
| CAS RN | 200877-99-2 |
| Standard InChI | InChI=1S/C20H24O7/c1-25-17-7-11(3-5-15(17)23)19-13(9-21)14(10-22)20(27-19)12-4-6-16(24)18(8-12)26-2/h3-8,13-14,19-24H,9-10H2,1-2H3/t13-,14-,19+,20+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H24O7/c1-25-17-7-11(3-5-15(17)23)19-13(9-21)14(10-22)20(27-19)12-4-6-16(24)18(8-12)26-2/h3-8,13-14,19-24H,9-10H2,1-2H3 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 38 |
| By standard InChI | CHEMBL464631 |
|---|---|
| By standard InChI Main Layer | CHEMBL464631 CHEMBL577783 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Thymelaeaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Daphne feddei | 66679 | Thymelaeaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P04278 | Sex hormone-binding globulin | Secreted protein | CHEMBL464631 |
CHEMBL944440
(1)
|
0 / 0 |