id | C00038191 |
---|---|
Name | 1-Hydroxyanthraquinone |
CAS RN | 129-43-1 |
Standard InChI | InChI=1S/C14H8O3/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7,15H |
Standard InChI (Main Layer) | InChI=1S/C14H8O3/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7,15H |
Phytochemical cluster | No. 62 |
---|---|
KCF-S cluster | No. 41 |
By standard InChI | CHEMBL501834 |
---|---|
By standard InChI Main Layer | CHEMBL501834 |
By LinkDB | C02980 |
---|
By CAS RN | C061208 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Morinda citrifolia | 43522 | Rubiaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL501834 |
CHEMBL941407
(1)
|
0 / 1 |