| id | C00038191 |
|---|---|
| Name | 1-Hydroxyanthraquinone |
| CAS RN | 129-43-1 |
| Standard InChI | InChI=1S/C14H8O3/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7,15H |
| Standard InChI (Main Layer) | InChI=1S/C14H8O3/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7,15H |
| Phytochemical cluster | No. 62 |
|---|---|
| KCF-S cluster | No. 41 |
| By standard InChI | CHEMBL501834 |
|---|---|
| By standard InChI Main Layer | CHEMBL501834 |
| By LinkDB | C02980 |
|---|
| By CAS RN | C061208 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Morinda citrifolia | 43522 | Rubiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL501834 |
CHEMBL941407
(1)
|
0 / 1 |