| id | C00039764 |
|---|---|
| Name | Mexicanolide |
| CAS RN | 1915-67-9 |
| Standard InChI | InChI=1S/C27H32O7/c1-25(2)19(12-20(28)32-5)27(4)17-6-8-26(3)18(15(17)10-16(22(25)30)23(27)31)11-21(29)34-24(26)14-7-9-33-13-14/h7,9,13,16-17,19,24H,6,8,10-12H2,1-5H3/t16-,17-,19-,24-,26+,27+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H32O7/c1-25(2)19(12-20(28)32-5)27(4)17-6-8-26(3)18(15(17)10-16(22(25)30)23(27)31)11-21(29)34-24(26)14-7-9-33-13-14/h7,9,13,16-17,19,24H,6,8,10-12H2,1-5H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 102 |
| By standard InChI | CHEMBL1080142 |
|---|---|
| By standard InChI Main Layer | CHEMBL1080142 CHEMBL1398245 CHEMBL1979074 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cedrela graziovii | 124946 | Meliaceae | rosids | Viridiplantae |
| Cedrela mexicana | 124946 | Meliaceae | rosids | Viridiplantae |
| Cedrela odorata | 124947 | Meliaceae | rosids | Viridiplantae |
| Ekebergia capensis | 124949 | Meliaceae | rosids | Viridiplantae |
| Khaya senegalensis | 587579 | Meliaceae | rosids | Viridiplantae |
| Swietenia mahagoni | 459165 | Meliaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O75604 | Ubiquitin carboxyl-terminal hydrolase 2 | Enzyme | CHEMBL1398245 |
CHEMBL1614331
(1)
|
0 / 0 |
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL1398245 |
CHEMBL1794311
(1)
|
2 / 3 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1398245 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |