| id | C00041984 |
|---|---|
| Name | Clusin / (-)-Clusin |
| CAS RN | 86992-94-1 |
| Standard InChI | InChI=1S/C22H26O7/c1-24-19-9-14(10-20(25-2)21(19)26-3)7-16-15(11-27-22(16)23)6-13-4-5-17-18(8-13)29-12-28-17/h4-5,8-10,15-16,22-23H,6-7,11-12H2,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C22H26O7/c1-24-19-9-14(10-20(25-2)21(19)26-3)7-16-15(11-27-22(16)23)6-13-4-5-17-18(8-13)29-12-28-17/h4-5,8-10,15-16,22-23H,6-7,11-12H2,1-3H3 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 1232 |
| By standard InChI | CHEMBL476708 |
|---|---|
| By standard InChI Main Layer | CHEMBL479701 CHEMBL476708 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 2 |
| family name | count |
|---|---|
| Hernandiaceae | 1 |
| Piperaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Hernandia nymphaeifolia | 121082 | Hernandiaceae | Magnoliophyta | Viridiplantae |
| Piper cubeba | 405322 | Piperaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL479701 |
CHEMBL970954
(1)
|
1 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL479701 |
CHEMBL970953
(1)
CHEMBL1743432
(2)
|
0 / 1 |