| id | C00043208 |
|---|---|
| Name | 5,6-Dehydro-7,8-dihydromethysticin |
| CAS RN | 3155-53-1 |
| Standard InChI | InChI=1S/C15H14O5/c1-17-12-7-11(20-15(16)8-12)4-2-10-3-5-13-14(6-10)19-9-18-13/h3,5-8H,2,4,9H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C15H14O5/c1-17-12-7-11(20-15(16)8-12)4-2-10-3-5-13-14(6-10)19-9-18-13/h3,5-8H,2,4,9H2,1H3 |
| Phytochemical cluster | No. 63 |
|---|---|
| KCF-S cluster | No. 1312 |
| By standard InChI | CHEMBL1376695 |
|---|---|
| By standard InChI Main Layer | CHEMBL1376695 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Piperaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Piper sanctum | 511552 | Piperaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1376695 |
CHEMBL1794401
(1)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1376695 |
CHEMBL1738588
(1)
|
0 / 0 |
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL1376695 |
CHEMBL1738442
(1)
|
0 / 0 |