| id | C00004649 |
|---|---|
| Name | Quercetin 7,3',4'-trimethyl ether / 3,5-Dihydroxy-7,3',4'-trimethoxyflavone / 2-(3,4-Dimethoxyphenyl)-3,5-dihydroxy-7-methoxy-4H-1-benzopyran-4-one |
| CAS RN | 6068-80-0 |
| Standard InChI | InChI=1S/C18H16O7/c1-22-10-7-11(19)15-14(8-10)25-18(17(21)16(15)20)9-4-5-12(23-2)13(6-9)24-3/h4-8,19,21H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H16O7/c1-22-10-7-11(19)15-14(8-10)25-18(17(21)16(15)20)9-4-5-12(23-2)13(6-9)24-3/h4-8,19,21H,1-3H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL1689343 |
|---|---|
| By standard InChI Main Layer | CHEMBL1689343 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 6 |
| rosids | 5 |
| eudicotyledons | 2 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Asteraceae | 3 |
| Boraginaceae | 1 |
| Hippocastanaceae | 1 |
| Cistaceae | 1 |
| Geraniaceae | 1 |
| Zygophyllaceae | 1 |
| Zingiberaceae | 1 |
| Solanaceae | 1 |
| Nyctaginaceae | 1 |
| Hydrophyllaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9UNQ0 | ATP-binding cassette sub-family G member 2 | ATP binding cassette | CHEMBL1689343 |
CHEMBL1694230
(1)
|
2 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #614490 | Blood group, junior system; jr |
Q9UNQ0
|
| #138900 | Uric acid concentration, serum, quantitative trait locus 1; uaqtl1 |
Q9UNQ0
|