| id | C00004692 |
|---|---|
| Name | Chrysosplenol D / Quercetagetin 3,6,7-Trimethyl ether / 5,3',4'-Trihydroxy-3,6,7-trimethoxyflavone / 2-(3,4-dihydroxyphenyl)-5-hydroxy-3,6,7-trimethoxy-4H-1-benzopyran-4-one |
| CAS RN | 14965-20-9 |
| Standard InChI | InChI=1S/C18H16O8/c1-23-12-7-11-13(14(21)17(12)24-2)15(22)18(25-3)16(26-11)8-4-5-9(19)10(20)6-8/h4-7,19-21H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H16O8/c1-23-12-7-11-13(14(21)17(12)24-2)15(22)18(25-3)16(26-11)8-4-5-9(19)10(20)6-8/h4-7,19-21H,1-3H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL491366 |
|---|---|
| By standard InChI Main Layer | CHEMBL491366 |
| By LinkDB | C04552 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 18 |
| rosids | 1 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Asteraceae | 16 |
| Saxifragaceae | 1 |
| Rosaceae | 1 |
| Lamiaceae | 1 |
| Hydrophyllaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P15121 | Aldose reductase | Enzyme | CHEMBL491366 |
CHEMBL1036011
(1)
CHEMBL1036012
(1)
CHEMBL1036013 (1) CHEMBL1036014 (1) |
0 / 0 |