| id | C00048438 |
|---|---|
| Name | Isopropanol |
| CAS RN | 67-63-0 |
| Standard InChI | InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6812 |
| By standard InChI | CHEMBL582 |
|---|---|
| By standard InChI Main Layer | CHEMBL582 |
| By LinkDB | C01845 |
|---|
| By CAS RN | D019840 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Citrus aurantifolia | 159033 | Rutaceae | rosids | Viridiplantae |
| Citrus aurantium | 43166 | Rutaceae | rosids | Viridiplantae |
| Citrus grandis | 37334 | Rutaceae | rosids | Viridiplantae |
| Citrus hystrix | 170989 | Rutaceae | rosids | Viridiplantae |
| Citrus limon | 2708 | Rutaceae | rosids | Viridiplantae |
| Citrus sinensis | 2711 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P02545 | Prelamin-A/C | Unclassified protein | CHEMBL582 |
CHEMBL1614544
(1)
|
11 / 10 |
| P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL582 |
CHEMBL1794561
(1)
|
3 / 1 |
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL582 |
CHEMBL1614458
(1)
|
0 / 0 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL582 |
CHEMBL2114890
(1)
|
0 / 0 |
| P10275 | Androgen receptor | NR3C4 | CHEMBL582 |
CHEMBL1794560
(1)
|
3 / 4 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| D019840 | 124 |
ADH1A
ADH1 |
alcohol dehydrogenase 1A (class I), alpha polypeptide (EC:1.1.1.1) | ADH1A protein results in increased oxidation of 2-Propanol |
increases oxidation
|
protein |
21167143
|
| D019840 | 125 |
ADH1B
ADH2 |
alcohol dehydrogenase 1B (class I), beta polypeptide (EC:1.1.1.1) | ADH1B protein results in increased oxidation of 2-Propanol |
increases oxidation
|
protein |
21167143
|
| D019840 | 126 |
ADH1C
ADH3 |
alcohol dehydrogenase 1C (class I), gamma polypeptide (EC:1.1.1.1) | ADH1C protein results in increased oxidation of 2-Propanol |
increases oxidation
|
protein |
21167143
|
| D019840 | 127 |
ADH4
ADH-2 |
alcohol dehydrogenase 4 (class II), pi polypeptide (EC:1.1.1.1) | ADH4 protein results in increased oxidation of 2-Propanol |
increases oxidation
|
protein |
21167143
|
| D019840 | 131 |
ADH7
ADH4 |
alcohol dehydrogenase 7 (class IV), mu or sigma polypeptide (EC:1.1.1.1) | ADH7 protein results in increased oxidation of 2-Propanol |
increases oxidation
|
protein |
21167143
|
| D019840 | 231 |
AKR1B1
ADR ALDR1 ALR2 AR |
aldo-keto reductase family 1, member B1 (aldose reductase) (EC:1.1.1.21) | 2-Propanol results in increased expression of AKR1B1 mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 57016 |
AKR1B10
AKR1B11 AKR1B12 ALDRLn ARL-1 ARL1 HIS HSI |
aldo-keto reductase family 1, member B10 (aldose reductase) (EC:1.1.1.2) | 2-Propanol results in increased expression of AKR1B10 mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 1645 |
AKR1C1
2-ALPHA-HSD 20-ALPHA-HSD C9 DD1 DD1/DD2 DDH DDH1 H-37 HAKRC HBAB MBAB |
aldo-keto reductase family 1, member C1 (EC:1.3.1.20 1.1.1.149 1.1.1.112) | 2-Propanol results in increased expression of AKR1C1 mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 8644 |
AKR1C3
DD3 DDX HA1753 HAKRB HAKRe HSD17B5 PGFS hluPGFS |
aldo-keto reductase family 1, member C3 (EC:1.3.1.20 1.1.1.188 1.1.1.239 1.1.1.64 1.1.1.112 1.1.1.357) | 2-Propanol results in increased expression of AKR1C3 mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 6347 |
CCL2
GDCF-2 HC11 HSMCR30 MCAF MCP-1 MCP1 SCYA2 SMC-CF |
chemokine (C-C motif) ligand 2 | 2-Propanol inhibits the reaction [lipopolysaccharide, Escherichia coli 0111 B4 results in increased secretion of CCL2 protein] |
decreases reaction
/ increases secretion |
protein |
22020770
|
| D019840 | 1135 |
CHRNA2
|
cholinergic receptor, nicotinic, alpha 2 (neuronal) | 2-Propanol promotes the reaction [Acetylcholine promotes the reaction [[CHRNA2 protein binds to CHRNB4 protein] which results in increased transport of Barium]] |
affects binding
/ increases reaction / increases transport |
protein |
11821649
|
| D019840 | 1143 |
CHRNB4
|
cholinergic receptor, nicotinic, beta 4 (neuronal) | 2-Propanol promotes the reaction [Acetylcholine promotes the reaction [[CHRNA2 protein binds to CHRNB4 protein] which results in increased transport of Barium]] |
affects binding
/ increases reaction / increases transport |
protein |
11821649
|
| D019840 | 2235 |
FECH
EPP FCE |
ferrochelatase (EC:4.99.1.1) | 2-Propanol results in increased expression of FECH mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 2353 |
FOS
AP-1 C-FOS p55 |
FBJ murine osteosarcoma viral oncogene homolog | 2-Propanol inhibits the reaction [lipopolysaccharide, Escherichia coli 0111 B4 affects the localization of FOS protein] |
affects localization
/ decreases reaction |
protein |
22020770
|
| D019840 | 2353 |
FOS
AP-1 C-FOS p55 |
FBJ murine osteosarcoma viral oncogene homolog | 2-Propanol results in decreased activity of FOS protein |
decreases activity
|
protein |
22020770
|
| D019840 | 2512 |
FTL
NBIA3 |
ferritin, light polypeptide | 2-Propanol results in increased expression of FTL mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 2539 |
G6PD
G6PD1 |
glucose-6-phosphate dehydrogenase (EC:1.1.1.49) | 2-Propanol results in increased expression of G6PD mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 2729 |
GCLC
GCL GCS GLCL GLCLC |
glutamate-cysteine ligase, catalytic subunit (EC:6.3.2.2) | 2-Propanol results in increased expression of GCLC mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 2730 |
GCLM
GLCLR |
glutamate-cysteine ligase, modifier subunit (EC:6.3.2.2) | 2-Propanol results in increased expression of GCLM mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 2688 |
GH1
GH GH-N GHN IGHD1B hGH-N |
growth hormone 1 | 2-Propanol affects the folding of GH1 protein |
affects folding
|
protein |
11064379
|
| D019840 | 2936 |
GSR
|
glutathione reductase (EC:1.8.1.7) | 2-Propanol results in increased expression of GSR mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 3033 |
HADH
HAD HADH1 HADHSC HCDH HHF4 MSCHAD SCHAD |
hydroxyacyl-CoA dehydrogenase (EC:1.1.1.35) | HADH protein results in increased metabolism of 2-Propanol |
increases metabolic processing
|
protein |
10600649
|
| D019840 | 3162 |
HMOX1
HMOX1D HO-1 HSP32 bK286B10 |
heme oxygenase (decycling) 1 (EC:1.14.99.3) | 2-Propanol results in increased expression of HMOX1 mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 3569 |
IL6
BSF2 HGF HSF IFNB2 IL-6 |
interleukin 6 (interferon, beta 2) | 2-Propanol promotes the reaction [lipopolysaccharide, Escherichia coli 0111 B4 results in increased secretion of IL6 protein] |
increases reaction
/ increases secretion |
protein |
22020770
|
| D019840 | 3725 |
JUN
AP-1 AP1 c-Jun |
jun proto-oncogene | 2-Propanol inhibits the reaction [lipopolysaccharide, Escherichia coli 0111 B4 affects the localization of JUN protein] |
affects localization
/ decreases reaction |
protein |
22020770
|
| D019840 | 3725 |
JUN
AP-1 AP1 c-Jun |
jun proto-oncogene | 2-Propanol results in decreased activity of JUN protein |
decreases activity
|
protein |
22020770
|
| D019840 | 4097 |
MAFG
hMAF |
v-maf avian musculoaponeurotic fibrosarcoma oncogene homolog G | 2-Propanol results in increased expression of MAFG mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 5594 |
MAPK1
ERK ERK2 ERT1 MAPK2 P42MAPK PRKM1 PRKM2 p38 p40 p41 p41mapk |
mitogen-activated protein kinase 1 (EC:2.7.11.24) | 2-Propanol inhibits the reaction [lipopolysaccharide, Escherichia coli 0111 B4 results in increased phosphorylation of MAPK1 protein] |
decreases reaction
/ increases phosphorylation |
protein |
22020770
|
| D019840 | 4199 |
ME1
HUMNDME MES |
malic enzyme 1, NADP(+)-dependent, cytosolic (EC:1.1.1.40) | 2-Propanol results in increased expression of ME1 mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 1728 |
NQO1
DHQU DIA4 DTD NMOR1 NMORI QR1 |
NAD(P)H dehydrogenase, quinone 1 (EC:1.6.5.2) | 2-Propanol results in increased expression of NQO1 mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 5226 |
PGD
6PGD |
phosphogluconate dehydrogenase (EC:1.1.1.44) | 2-Propanol results in increased expression of PGD mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 22949 |
PTGR1
LTB4DH PGR1 ZADH3 |
prostaglandin reductase 1 (EC:1.3.1.48 1.3.1.74) | 2-Propanol results in increased expression of PTGR1 mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 140809 |
SRXN1
C20orf139 Npn3 SRX SRX1 |
sulfiredoxin 1 (EC:1.8.98.2) | 2-Propanol results in increased expression of SRXN1 mRNA |
increases expression
|
mRNA |
20566472
|
| D019840 | 7124 |
TNF
DIF TNF-alpha TNFA TNFSF2 |
tumor necrosis factor | 2-Propanol inhibits the reaction [lipopolysaccharide, Escherichia coli 0111 B4 results in increased secretion of TNF protein] |
decreases reaction
/ increases secretion |
protein |
22020770
|
| D019840 | 7296 |
TXNRD1
GRIM-12 TR TR1 TRXR1 TXNR |
thioredoxin reductase 1 (EC:1.8.1.9) | 2-Propanol results in increased expression of TXNRD1 mRNA |
increases expression
|
mRNA |
20566472
|
| OMIM | preferred title | UniProt |
|---|---|---|
| #300068 | Androgen insensitivity syndrome; ais |
P10275
|
| #312300 | Androgen insensitivity, partial; pais |
P10275
|
| #115200 | Cardiomyopathy, dilated, 1a; cmd1a |
P02545
|
| #212112 | Cardiomyopathy, dilated, with hypergonadotropic hypogonadism |
P02545
|
| #605588 | Charcot-marie-tooth disease, axonal, type 2b1; cmt2b1 |
P02545
|
| #181350 | Emery-dreifuss muscular dystrophy 2, autosomal dominant; edmd2 |
P02545
|
| #610140 | Heart-hand syndrome, slovenian type |
P02545
|
| #176670 | Hutchinson-gilford progeria syndrome; hgps |
P02545
|
| #151660 | Lipodystrophy, familial partial, type 2; fpld2 |
P02545
|
| #248370 | Mandibuloacral dysplasia with type a lipodystrophy; mada |
P02545
|
| #613205 | Muscular dystrophy, congenital, lmna-related |
P02545
|
| #159001 | Muscular dystrophy, limb-girdle, type 1b; lgmd1b |
P02545
|
| #275210 | Restrictive dermopathy, lethal |
P02545
|
| #313200 | Spinal and bulbar muscular atrophy, x-linked 1; smax1 |
P10275
|
| #188570 | Thyroid hormone resistance, generalized, autosomal dominant; grth |
P10828
|
| #274300 | Thyroid hormone resistance, generalized, autosomal recessive; grth |
P10828
|
| #145650 | Thyroid hormone resistance, selective pituitary; prth |
P10828
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00264 | Charcot-Marie-Tooth disease (CMT) |
P02545
(related)
|
| H00294 | Dilated cardiomyopathy (DCM) |
P02545
(related)
|
| H00420 | Familial partial lipodystrophy (FPL) |
P02545
(related)
|
| H00563 | Emery-Dreifuss muscular dystrophy |
P02545
(related)
|
| H00590 | Congenital muscular dystrophies (CMD/MDC) |
P02545
(related)
|
| H00593 | Limb-girdle muscular dystrophy (LGMD) |
P02545
(related)
|
| H00601 | Hutchinson-Gilford progeria syndrome |
P02545
(related)
|
| H00663 | Restrictive dermopathy |
P02545
(related)
|
| H00665 | Mandibuloacral dysplasia |
P02545
(related)
|
| H01216 | Left ventricular noncompaction (LVNC) |
P02545
(related)
|
| H00024 | Prostate cancer |
P10275
(related)
|
| H00062 | Spinal and bulbar muscular atrophy (SBMA) |
P10275
(related)
|
| H00608 | 46,XY disorders of sex development (Disorders in androgen synthesis or action) |
P10275
(related)
|
| H00609 | 46,XY disorders of sex development (Other) |
P10275
(related)
|
| H00249 | Thyroid hormone resistance syndrome |
P10828
(related)
|