id | C00005219 |
---|---|
Name | Clitorin / Kaempferol 3-(2G-rhamnosylrutinoside) |
CAS RN | 55804-74-5 |
Standard InChI | InChI=1S/C33H40O19/c1-10-19(37)23(41)26(44)31(47-10)46-9-17-21(39)25(43)30(52-32-27(45)24(42)20(38)11(2)48-32)33(50-17)51-29-22(40)18-15(36)7-14(35)8-16(18)49-28(29)12-3-5-13(34)6-4-12/h3-8,10-11,17,19-21,23-27,30-39,41-45H,9H2,1-2H3/t10?,11?,17?,19-,20-,21+,23-,24?,25?,26?,27-,30?,31+,32-,33-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C33H40O19/c1-10-19(37)23(41)26(44)31(47-10)46-9-17-21(39)25(43)30(52-32-27(45)24(42)20(38)11(2)48-32)33(50-17)51-29-22(40)18-15(36)7-14(35)8-16(18)49-28(29)12-3-5-13(34)6-4-12/h3-8,10-11,17,19-21,23-27,30-39,41-45H,9H2,1-2H3 |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 5 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL362593 CHEMBL1454324 CHEMBL2005346 |
By LinkDB |
---|
By CAS RN | C077190 |
---|
class name | count |
---|---|
asterids | 9 |
rosids | 4 |
Liliopsida | 1 |
family name | count |
---|---|
Fabaceae | 4 |
Cornaceae | 2 |
Solanaceae | 2 |
Primulaceae | 2 |
Lamiaceae | 1 |
Adoxaceae | 1 |
Typhaceae | 1 |
Apocynaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL362593 |
CHEMBL832445
(1)
CHEMBL832449
(1)
CHEMBL832450 (1) |
0 / 0 |