| id | C00005538 |
|---|---|
| Name | Isorhamnetin 3-robinobioside / Isorhamnetin 3-O-robinobioside |
| CAS RN | 53584-69-3 |
| Standard InChI | InChI=1S/C28H32O16/c1-9-18(32)21(35)23(37)27(41-9)40-8-16-19(33)22(36)24(38)28(43-16)44-26-20(34)17-13(31)6-11(29)7-15(17)42-25(26)10-3-4-12(30)14(5-10)39-2/h3-7,9,16,18-19,21-24,27-33,35-38H,8H2,1-2H3/t9?,16?,18-,19-,21-,22?,23?,24?,27+,28-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C28H32O16/c1-9-18(32)21(35)23(37)27(41-9)40-8-16-19(33)22(36)24(38)28(43-16)44-26-20(34)17-13(31)6-11(29)7-15(17)42-25(26)10-3-4-12(30)14(5-10)39-2/h3-7,9,16,18-19,21-24,27-33,35-38H,8H2,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 1 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL84174 CHEMBL258394 CHEMBL1711509 CHEMBL2165403 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 5 |
| eudicotyledons | 3 |
| rosids | 2 |
| Magnoliophyta | 1 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Amaranthaceae | 2 |
| Primulaceae | 2 |
| Strombosiaceae | 1 |
| Asparagaceae | 1 |
| Actinidiaceae | 1 |
| Campanulaceae | 1 |
| Asteraceae | 1 |
| Aristolochiaceae | 1 |
| Nitrariaceae | 1 |
| Rosaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P07237 | Protein disulfide-isomerase | Enzyme | CHEMBL1711509 |
CHEMBL1964080
(1)
CHEMBL2114805
(1)
|
0 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL1711509 |
CHEMBL2114843
(1)
|
0 / 0 |
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1711509 |
CHEMBL2114788
(1)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1711509 |
CHEMBL1738588
(1)
|
0 / 0 |
| P03372 | Estrogen receptor | NR3A1 | CHEMBL258394 |
CHEMBL1941568
(1)
CHEMBL1941569
(1)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL258394 |
CHEMBL972070
(1)
|
0 / 1 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1711509 |
CHEMBL1794483
(1)
|
0 / 0 |