| id | C00006446 |
|---|---|
| Name | Taiwaniaflavone |
| CAS RN | 27090-22-8 |
| Standard InChI | InChI=1S/C30H18O10/c31-15-4-1-13(2-5-15)30-26(29(38)28-21(36)9-17(33)11-25(28)40-30)18-7-14(3-6-19(18)34)23-12-22(37)27-20(35)8-16(32)10-24(27)39-23/h1-12,31-36H |
| Standard InChI (Main Layer) | InChI=1S/C30H18O10/c31-15-4-1-13(2-5-15)30-26(29(38)28-21(36)9-17(33)11-25(28)40-30)18-7-14(3-6-19(18)34)23-12-22(37)27-20(35)8-16(32)10-24(27)39-23/h1-12,31-36H |
| Phytochemical cluster | No. 18 |
|---|---|
| KCF-S cluster | No. 34 |
| By standard InChI | CHEMBL272861 |
|---|---|
| By standard InChI Main Layer | CHEMBL272861 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 2 |
| family name | count |
|---|---|
| Cupressaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Calocedrus microlepic var. formosana | 13386 | Cupressaceae | Spermatophyta | Viridiplantae |
| Taiwania cryptomerioides | 50187 | Cupressaceae | Spermatophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P08253 | 72 kDa type IV collagenase | M10A | CHEMBL272861 |
CHEMBL945961
(1)
|
1 / 3 |